Compare commits
60 Commits
ecba40f189
...
v1-final
| Author | SHA1 | Date | |
|---|---|---|---|
| 1f58bb8016 | |||
| 31d21ec551 | |||
| 2b976cf872 | |||
| 39212aaf81 | |||
| 7acda7f55f | |||
| c59072eff2 | |||
| 176b75328f | |||
| 7eb3d11f02 | |||
| 6658de02f4 | |||
| a9c40368d3 | |||
| 98774453b3 | |||
| d8570eaa2d | |||
| 68a6b4763b | |||
| 8efa8ba0d1 | |||
| 6ed074dbbf | |||
| 5c63d877f0 | |||
| 906037f974 | |||
| 78f56a68b0 | |||
| 5cf994ec4b | |||
| 9bc3b12745 | |||
| 45d4c197ba | |||
| 8b9fc31bcd | |||
| fbbd3e7277 | |||
| 1a14f7c420 | |||
| 139a355ef3 | |||
| 7d5bd33bb5 | |||
| 18a8347765 | |||
| 856ff239d6 | |||
| 732e41ec3a | |||
| 39a3420a8e | |||
| 03232be7b1 | |||
| 44a5b4aac5 | |||
| 1badc370ab | |||
| 0bc0c24c1c | |||
| f61616d76a | |||
| e07c26c6fe | |||
| 68ebee7432 | |||
| dc34b7f6d5 | |||
| b6dc15e19e | |||
| b411eaac25 | |||
| e3a79d4888 | |||
| 6d443df3ec | |||
| d954b2b816 | |||
| 43aea01fb5 | |||
| 709612ece4 | |||
| b38194c4d9 | |||
| 634bf611c9 | |||
| 612a21f561 | |||
| abc7d5f013 | |||
| c3125b458b | |||
| cd7f7e8aa9 | |||
| fbdafb9a37 | |||
| fc1c1dc142 | |||
| 97fe055b8d | |||
| 89e0ffbbf2 | |||
| 20d035205a | |||
| e6f98ac921 | |||
| 9a5f086684 | |||
| 070a211c69 | |||
| 4c3457c17c |
@@ -78,7 +78,10 @@
|
||||
"Skill(ralph-loop:ralph-loop)",
|
||||
"Skill(ralph-loop:ralph-loop:*)",
|
||||
"mcp__Claude_in_Chrome__computer",
|
||||
"mcp__Claude_in_Chrome__navigate"
|
||||
"mcp__Claude_in_Chrome__navigate",
|
||||
"Bash(/c/Users/antoi/anaconda3/envs/atomizer/python.exe -m pip install:*)",
|
||||
"Bash(/c/Users/antoi/anaconda3/envs/atomizer/python.exe tests/compare_triangle_vs_gmsh.py)",
|
||||
"Bash(/c/Users/antoi/anaconda3/envs/atomizer/python.exe:*)"
|
||||
],
|
||||
"deny": [],
|
||||
"ask": []
|
||||
|
||||
3
.gitignore
vendored
3
.gitignore
vendored
@@ -139,3 +139,6 @@ docs/generated/
|
||||
# Malformed filenames (Windows path used as filename)
|
||||
C:*
|
||||
*.gitmodules
|
||||
|
||||
# project-context-sync (auto-generated, local only)
|
||||
PROJECT_STATE.md
|
||||
|
||||
21
.project-context.yml
Normal file
21
.project-context.yml
Normal file
@@ -0,0 +1,21 @@
|
||||
# project-context-sync configuration
|
||||
# See: https://github.com/clawdbot/skills/project-context-sync
|
||||
|
||||
project_context:
|
||||
# Use AI to generate smart summaries
|
||||
# true: Rich context with inferred focus and suggestions (uses tokens)
|
||||
# false: Raw git info only (fast, free)
|
||||
ai_summary: true
|
||||
|
||||
# How many recent commits to show
|
||||
recent_commits: 5
|
||||
|
||||
# Include file change stats in output
|
||||
include_diff_stats: true
|
||||
|
||||
# Sections to include in PROJECT_STATE.md
|
||||
sections:
|
||||
- last_commit # Always included
|
||||
- recent_changes # Recent commit list
|
||||
- current_focus # AI-generated (requires ai_summary: true)
|
||||
- suggested_next # AI-generated (requires ai_summary: true)
|
||||
215
docs/hq/13-TASKBOARD-KANBAN-DYNAMIC-PROJECT-ORCHESTRATION.md
Normal file
215
docs/hq/13-TASKBOARD-KANBAN-DYNAMIC-PROJECT-ORCHESTRATION.md
Normal file
@@ -0,0 +1,215 @@
|
||||
---
|
||||
tags:
|
||||
- Project/Atomizer
|
||||
- Agentic
|
||||
- Orchestration
|
||||
- Plan
|
||||
date: 2026-02-17
|
||||
status: planning
|
||||
owner: Antoine + Mario
|
||||
---
|
||||
|
||||
# 13 — Taskboard / Kanban / Dynamic Project Orchestration
|
||||
|
||||
## Problem Statement
|
||||
|
||||
The current orchestration is broken. Agents exist, delegation works mechanically (hooks API), but there's no **structured workflow** tying it together. `PROJECT_STATUS.md` is a flat file that Manager edits manually — it's not a real kanban. There's no enforced flow from task creation → assignment → execution → deliverable → summary. Deliverables land wherever instead of in the right Discord channels. Antoine has no visibility into what Manager is planning or how agents are being pulled.
|
||||
|
||||
**What we need:** A file-based taskboard that serves as the orchestration backbone — agents read it, update it, and Manager uses it to drive all collaboration. The frontend dashboard is secondary; the data and workflow come first.
|
||||
|
||||
---
|
||||
|
||||
## Architecture
|
||||
|
||||
### 1. Taskboard: `shared/taskboard.json`
|
||||
|
||||
Single source of truth for all active work. JSON array of task objects.
|
||||
|
||||
```json
|
||||
{
|
||||
"version": 1,
|
||||
"lastUpdated": "2026-02-17T01:00:00Z",
|
||||
"updatedBy": "manager",
|
||||
"tasks": [
|
||||
{
|
||||
"id": "TASK-001",
|
||||
"title": "Research Clearceram-Z HS thermal properties",
|
||||
"description": "Full thermal property comparison: CTE, conductivity, diffusivity for CCZ HS vs Zerodur Class 0",
|
||||
"status": "in-progress",
|
||||
"priority": "high",
|
||||
"assignee": "webster",
|
||||
"requestedBy": "manager",
|
||||
"project": "gigabit-m2",
|
||||
"deliverable": {
|
||||
"type": "analysis",
|
||||
"targetChannel": "technical",
|
||||
"format": "Discord post with data table"
|
||||
},
|
||||
"created": "2026-02-17T01:00:00Z",
|
||||
"updated": "2026-02-17T01:15:00Z",
|
||||
"dueBy": null,
|
||||
"notes": [],
|
||||
"completedAt": null
|
||||
}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
#### Task Schema
|
||||
|
||||
| Field | Type | Description |
|
||||
|-------|------|-------------|
|
||||
| `id` | string | Auto-incremented `TASK-NNN` |
|
||||
| `title` | string | Short description |
|
||||
| `description` | string | Full context for the assignee |
|
||||
| `status` | enum | `backlog` → `todo` → `in-progress` → `review` → `done` → `cancelled` |
|
||||
| `priority` | enum | `critical`, `high`, `medium`, `low` |
|
||||
| `assignee` | string | Agent name (or `antoine` for CEO tasks) |
|
||||
| `requestedBy` | string | Who created it |
|
||||
| `project` | string | Project tag for grouping |
|
||||
| `deliverable.type` | enum | `document`, `code`, `analysis`, `recommendation`, `review`, `data` |
|
||||
| `deliverable.targetChannel` | string | Discord channel where result gets posted |
|
||||
| `deliverable.format` | string | Expected output format |
|
||||
| `created` | ISO datetime | When task was created |
|
||||
| `updated` | ISO datetime | Last status change |
|
||||
| `dueBy` | ISO datetime or null | Deadline if any |
|
||||
| `notes` | array of strings | Status updates, blockers, progress notes |
|
||||
| `completedAt` | ISO datetime or null | When marked done |
|
||||
|
||||
#### Status Flow
|
||||
|
||||
```
|
||||
backlog → todo → in-progress → review → done
|
||||
↓
|
||||
cancelled
|
||||
```
|
||||
|
||||
- **backlog**: Identified but not yet prioritized
|
||||
- **todo**: Ready to be picked up
|
||||
- **in-progress**: Agent is actively working
|
||||
- **review**: Deliverable produced, awaiting Manager/Antoine review
|
||||
- **done**: Accepted and posted to Discord
|
||||
- **cancelled**: Dropped (with reason in notes)
|
||||
|
||||
### 2. Orchestration Plan: `shared/orchestration-log.md`
|
||||
|
||||
Append-only log where Manager posts orchestration plans **before** kicking off work. This gives Antoine visibility into what's happening and why.
|
||||
|
||||
Format:
|
||||
```markdown
|
||||
## [2026-02-17 01:00] Orchestration: Material Comparison for M2/M3
|
||||
|
||||
**Objective:** Compare Zerodur Class 0 vs Clearceram-Z HS for M2/M3 mirrors
|
||||
**Tasks created:** TASK-001, TASK-002, TASK-003
|
||||
**Agent assignments:**
|
||||
- Webster → material property research (TASK-001)
|
||||
- Tech-Lead → structural impact analysis (TASK-002)
|
||||
- Secretary → compile final comparison report (TASK-003, after 001+002)
|
||||
|
||||
**Dependencies:** TASK-003 waits on TASK-001 + TASK-002
|
||||
**Expected output:** Comparison report in #reports, raw data in #technical
|
||||
**ETA:** ~2 hours
|
||||
|
||||
---
|
||||
```
|
||||
|
||||
### 3. Agent Protocols
|
||||
|
||||
#### Manager (orchestrator)
|
||||
- **ONLY writer** of `taskboard.json` (creates, assigns, updates status)
|
||||
- Posts orchestration plans to `orchestration-log.md` before delegating
|
||||
- Posts orchestration summaries to Discord `#feed`
|
||||
- Reviews deliverables before marking tasks `done`
|
||||
- Reads `project_log.md` for agent status updates
|
||||
|
||||
#### Assigned Agents (executor)
|
||||
- Read their tasks from `taskboard.json` (filter by `assignee`)
|
||||
- Append progress to `shared/project_log.md` (append-only, never edit taskboard directly)
|
||||
- Post deliverables to the `deliverable.targetChannel` specified in the task
|
||||
- Log format: `[YYYY-MM-DD HH:MM] [agent] TASK-NNN: <update>`
|
||||
|
||||
#### Secretary (condensation)
|
||||
- After orchestration chains complete, Secretary **must** be the final step
|
||||
- Reads completed tasks + deliverables from the chain
|
||||
- Produces a condensation/summary
|
||||
- Posts distillate to Discord `#reports`
|
||||
- Updates `shared/orchestration-log.md` with completion status
|
||||
|
||||
### 4. Deliverable Routing
|
||||
|
||||
Every deliverable has a home. Manager specifies the target channel when creating the task.
|
||||
|
||||
| Deliverable Type | Default Channel | Description |
|
||||
|-----------------|-----------------|-------------|
|
||||
| `document` | `#reports` | Reports, summaries, formal docs |
|
||||
| `code` | `#technical` | Scripts, configs, implementations |
|
||||
| `analysis` | `#technical` | FEA results, data analysis, comparisons |
|
||||
| `recommendation` | `#reports` | Decision support, trade studies |
|
||||
| `review` | `#reports` | Audits, quality checks |
|
||||
| `data` | `#knowledge-base` | Raw data, material properties, reference info |
|
||||
|
||||
Manager can override the default channel per task.
|
||||
|
||||
### 5. Discord Channel Usage (refined)
|
||||
|
||||
| Channel | Purpose | Who Posts |
|
||||
|---------|---------|-----------|
|
||||
| `#reports` | Final summaries, orchestration distillates | Secretary (primary), Manager |
|
||||
| `#feed` | Orchestration plans, sprint status, kanban snapshots | Manager |
|
||||
| `#technical` | Technical work, analysis results, code | Tech-Lead, Optimizer, NX-Expert, Webster |
|
||||
| `#knowledge-base` | Permanent reference data, lessons learned | Any agent |
|
||||
| `#announcements` | Major decisions, milestones | Manager, Antoine |
|
||||
| `#agent-logs` | Verbose process logs (not for Antoine) | Any agent |
|
||||
|
||||
---
|
||||
|
||||
## Implementation Plan
|
||||
|
||||
### Phase 1: Foundation (immediate)
|
||||
1. Create `shared/taskboard.json` with empty task list
|
||||
2. Create `shared/orchestration-log.md`
|
||||
3. Create `shared/skills/taskboard/` — shell scripts for agents to:
|
||||
- `read-tasks.sh <agent>` — list my assigned tasks
|
||||
- `update-status.sh <task-id> <status> [note]` — log progress (appends to project_log.md)
|
||||
- `create-task.sh` — Manager only, adds task to taskboard
|
||||
- `complete-task.sh <task-id>` — Manager only, marks done
|
||||
4. Update Manager's `AGENTS.md` with orchestration protocol
|
||||
5. Update Secretary's `AGENTS.md` with condensation protocol
|
||||
6. Update all agents' `AGENTS.md` with task-reading protocol
|
||||
|
||||
### Phase 2: Workflow enforcement
|
||||
1. Manager HEARTBEAT checks taskboard for stale tasks (in-progress > 4h with no updates)
|
||||
2. Secretary HEARTBEAT checks for completed orchestration chains needing condensation
|
||||
3. Kanban snapshot posted to `#feed` by Manager (daily or on-demand)
|
||||
|
||||
### Phase 3: Dashboard integration (later, CEO view)
|
||||
1. Dashboard backend reads `taskboard.json` directly
|
||||
2. Frontend renders kanban board
|
||||
3. Antoine can view/filter tasks, see agent activity
|
||||
4. Eventually: approve/reject deliverables from dashboard
|
||||
|
||||
---
|
||||
|
||||
## Key Principles
|
||||
|
||||
1. **File-based, not API-based** — `taskboard.json` is the single source of truth. No database needed. Every agent can read it. Only Manager writes it.
|
||||
2. **Append-only logs** — Agents never edit shared state directly. They append to `project_log.md`. Manager synthesizes.
|
||||
3. **Orchestration plans are visible** — Manager always posts the plan before executing. Antoine sees what's coming.
|
||||
4. **Secretary is always the last step** — Every orchestration chain ends with Secretary producing a readable summary for Discord.
|
||||
5. **Deliverables go to the right place** — Target channel is part of the task definition, not an afterthought.
|
||||
6. **Progressive automation** — Start with scripts + protocols. Dashboard frontend comes later when the workflow is proven.
|
||||
|
||||
---
|
||||
|
||||
## Dependencies
|
||||
|
||||
- Delegate skill already works (hooks API)
|
||||
- Discord channels exist
|
||||
- Agent workspaces exist
|
||||
- `project_log.md` append pattern already in use
|
||||
|
||||
## Risks
|
||||
|
||||
- Agents may not reliably read taskboard on every session (mitigate: add to HEARTBEAT.md)
|
||||
- JSON file corruption if multiple writers (mitigate: Manager is sole writer)
|
||||
- Task staleness if agents don't report progress (mitigate: Manager heartbeat checks)
|
||||
5
hq/.gitignore
vendored
5
hq/.gitignore
vendored
@@ -4,3 +4,8 @@ job-queue/inbox/*
|
||||
job-queue/outbox/*
|
||||
job-queue/archive/*
|
||||
!job-queue/*/.gitkeep
|
||||
discord-bridge/node_modules/
|
||||
instances/*/browser/
|
||||
|
||||
bridge/node_modules/
|
||||
node_modules/
|
||||
|
||||
48
hq/CHANNELS.md
Normal file
48
hq/CHANNELS.md
Normal file
@@ -0,0 +1,48 @@
|
||||
# Atomizer HQ — Discord Channel Guide
|
||||
|
||||
## How It Works
|
||||
- **Shared channels:** Agents only respond when `@mentioned` by name
|
||||
- **Direct messages (`#dm-{agent}`):** No mention needed — that agent always listens
|
||||
- **New project?** Start exploring in `#rnd`. When it's serious → Manager creates a `#proj-*` channel.
|
||||
|
||||
## Standing Channels (📋 HQ)
|
||||
|
||||
| Channel | Purpose | Who to @mention |
|
||||
|---------|---------|-----------------|
|
||||
| **#hq** | CEO directives & general command | Manager listens automatically; @mention others |
|
||||
| **#feed** | Activity feed — what's happening across the org | Any agent (they post updates here) |
|
||||
| **#technical** | Engineering discussion | @Tech Lead, @Optimizer, @NX Expert |
|
||||
| **#rnd** | R&D, ideas, experiments — before they earn a project | Any agent |
|
||||
| **#lessons-learned** | Permanent post-mortems. Survives project archival. | @Auditor enforces |
|
||||
| **#knowledge-base** | Curated reference material (not discussion) | Any agent to query |
|
||||
| **#it** | Infrastructure & ops | @Webster |
|
||||
|
||||
## Project Channels (🏗️ PROJECTS)
|
||||
Dynamic — Manager creates `#proj-*` channels as needed.
|
||||
|
||||
| Channel | Project |
|
||||
|---------|---------|
|
||||
| **#proj-hydrotech-beam** | Hydrotech Beam |
|
||||
|
||||
## Direct Messages (📨 DIRECT LINES)
|
||||
No @mention needed — the agent always listens in their DM channel.
|
||||
|
||||
| Channel | Agent |
|
||||
|---------|-------|
|
||||
| `#dm-manager` | Manager |
|
||||
| `#dm-tech-lead` | Tech Lead |
|
||||
| `#dm-secretary` | Secretary |
|
||||
| `#dm-auditor` | Auditor |
|
||||
| `#dm-optimizer` | Optimizer |
|
||||
| `#dm-study-builder` | Study Builder |
|
||||
| `#dm-nx-expert` | NX Expert |
|
||||
| `#dm-webster` | Webster |
|
||||
|
||||
## What's Different From Before
|
||||
- **#feed** is the game-changer — no more guessing what's happening
|
||||
- **#lessons-learned** is permanent — survives project archival, Auditor enforces post-mortems
|
||||
- **#knowledge-base** stays as curated reference (not discussion — use #rnd or #technical)
|
||||
- **#rnd** gives ideas a place to live before they earn a project channel
|
||||
- **#it** separates infra noise from real work
|
||||
- Direct lines renamed `#dm-*` for clarity
|
||||
- 6 standing + 8 direct lines + dynamic project channels = clean but powerful
|
||||
@@ -1,44 +0,0 @@
|
||||
#!/usr/bin/env bash
|
||||
# Atomizer Cluster Management Script
|
||||
set -euo pipefail
|
||||
|
||||
AGENTS=(manager tech-lead secretary auditor optimizer study-builder nx-expert webster)
|
||||
SERVICE_PREFIX="openclaw-atomizer@"
|
||||
|
||||
case "${1:-help}" in
|
||||
start)
|
||||
for a in "${AGENTS[@]}"; do
|
||||
echo "Starting ${a}..."
|
||||
systemctl --user enable --now "${SERVICE_PREFIX}${a}.service"
|
||||
done
|
||||
echo "All agents started."
|
||||
;;
|
||||
stop)
|
||||
for a in "${AGENTS[@]}"; do
|
||||
echo "Stopping ${a}..."
|
||||
systemctl --user stop "${SERVICE_PREFIX}${a}.service" || true
|
||||
done
|
||||
echo "All agents stopped."
|
||||
;;
|
||||
restart)
|
||||
for a in "${AGENTS[@]}"; do
|
||||
echo "Restarting ${a}..."
|
||||
systemctl --user restart "${SERVICE_PREFIX}${a}.service"
|
||||
done
|
||||
echo "All agents restarted."
|
||||
;;
|
||||
status)
|
||||
for a in "${AGENTS[@]}"; do
|
||||
systemctl --user status "${SERVICE_PREFIX}${a}.service" --no-pager -l 2>/dev/null | head -3
|
||||
echo "---"
|
||||
done
|
||||
;;
|
||||
logs)
|
||||
agent="${2:-manager}"
|
||||
journalctl --user -u "${SERVICE_PREFIX}${agent}.service" -f --no-pager
|
||||
;;
|
||||
*)
|
||||
echo "Usage: $0 {start|stop|restart|status|logs [agent]}"
|
||||
exit 1
|
||||
;;
|
||||
esac
|
||||
@@ -1,11 +0,0 @@
|
||||
{
|
||||
"schemaVersion": "1.0",
|
||||
"runId": "orch-1771176737-8c14d6cf",
|
||||
"agent": "webster",
|
||||
"status": "failed",
|
||||
"result": null,
|
||||
"artifacts": [],
|
||||
"confidence": "low",
|
||||
"notes": "web_search tool failed due to a missing Brave API key. I am unable to access the internet to find the density of Zerodur.",
|
||||
"timestamp": "2026-02-15T12:32:00-05:00"
|
||||
}
|
||||
@@ -1,11 +0,0 @@
|
||||
{
|
||||
"schemaVersion": "1.0",
|
||||
"runId": "orch-1771176838-52dc0c1b",
|
||||
"agent": "webster",
|
||||
"status": "blocked",
|
||||
"result": "Could not retrieve CTE and density for Clearceram-Z HS.",
|
||||
"artifacts": [],
|
||||
"confidence": "low",
|
||||
"notes": "The primary data source appears to be a PDF file (https://oharacorp.com/wp-content/uploads/2022/11/clearerem.pdf). My current tools are unable to parse PDF files to extract the required data. I was also unable to find the data in a standard HTML or text format.",
|
||||
"timestamp": "2026-02-15T12:35:45-05:00"
|
||||
}
|
||||
17
hq/handoffs/orch-1771263706-c8a924bf.json
Normal file
17
hq/handoffs/orch-1771263706-c8a924bf.json
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771263706-c8a924bf",
|
||||
"agent": "tech-lead",
|
||||
"status": "complete",
|
||||
"result": "**Al 6061-T6 vs 7075-T6 for a Lightweight Bracket — Thermal & Structural Trade-offs**\n\n• **Strength-to-weight:** 7075-T6 is significantly stronger (UTS ~572 MPa, yield ~503 MPa) vs 6061-T6 (UTS ~310 MPa, yield ~276 MPa) at nearly the same density (~2.81 vs 2.70 g/cm³). For a weight-critical bracket, 7075 allows thinner sections and less material for the same load capacity.\n\n• **Thermal conductivity:** 6061-T6 has notably higher thermal conductivity (~167 W/m·K) compared to 7075-T6 (~130 W/m·K). If the bracket must conduct heat away (e.g., heat sink function or thermal path in an assembly), 6061 is the better choice. 6061 also has a slightly higher CTE (~23.6 vs ~23.2 µm/m·°C), though the difference is minor.\n\n• **Thermal stress risk:** In applications with significant temperature gradients or thermal cycling, the lower yield strength of 6061 means it reaches plastic deformation sooner under thermally-induced stresses. 7075's higher yield gives more margin against thermal distortion, but its lower ductility (~11% vs ~17% elongation) means less warning before fracture under combined thermal + mechanical loads.\n\n• **Recommendation:** Choose **7075-T6** when the bracket is purely structural and weight is the primary driver. Choose **6061-T6** when thermal management matters (heat dissipation, thermal path), when weldability is needed, or when cost is a concern (6061 is cheaper and easier to machine/weld). For thermally cycled environments with high structural demand, consider 7075 but add fatigue/fracture analysis due to its lower ductility.",
|
||||
"deliverable": {
|
||||
"type": "recommendation",
|
||||
"title": "Al 6061-T6 vs 7075-T6 Bracket Material Comparison",
|
||||
"path": null,
|
||||
"summary": "Structural and thermal trade-off summary for lightweight bracket material selection"
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "Standard handbook values used. For precision-critical applications, verify properties against supplier certs for the specific temper and product form.",
|
||||
"timestamp": "2026-02-16T12:41:00-05:00"
|
||||
}
|
||||
19
hq/handoffs/orch-1771264616-aea2c906.json
Normal file
19
hq/handoffs/orch-1771264616-aea2c906.json
Normal file
@@ -0,0 +1,19 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771264616-aea2c906",
|
||||
"agent": "tech-lead",
|
||||
"status": "complete",
|
||||
"result": "CEO decision logged: 7075-T6 selected for lightweight bracket, prioritizing structural performance.\n\n**Project docs created:**\n- `/home/papa/atomizer/hq/projects/lightweight-bracket/CONTEXT.md` — full project context with material decision, properties, and design plan\n\n**Next design phase plan (4 phases):**\n\n1. **Requirements & Baseline** — Define load cases, geometric envelope, performance targets, create baseline CAD. This is the immediate next step and requires input from CEO/Manager on loads, constraints, and function.\n\n2. **FEA Baseline Analysis** — Mesh convergence study, SOL 101 static + SOL 103 modal, hand-calc validation.\n\n3. **Design Optimization** — Topology/parametric optimization via Atomizer LAC pattern. Minimize mass subject to stress and displacement constraints.\n\n4. **Validation & Deliverables** — Final mesh convergence, margin of safety report, fatigue assessment if needed, ductility check (7075-T6 at 11% elongation).\n\n**7 open gaps identified** (G1–G7) — all related to missing requirements (loads, geometry, manufacturing, FOS). These must be resolved before Phase 2 can begin.\n\n**Immediate action needed:** CEO/Manager to provide bracket function, load cases, and geometric envelope to proceed past Phase 1.",
|
||||
"deliverable": {
|
||||
"type": "document",
|
||||
"title": "Lightweight Bracket Project Context & Design Plan",
|
||||
"path": "/home/papa/atomizer/hq/projects/lightweight-bracket/CONTEXT.md",
|
||||
"summary": "Project context documenting 7075-T6 selection and 4-phase design/analysis plan with 7 open gaps"
|
||||
},
|
||||
"artifacts": [
|
||||
"/home/papa/atomizer/hq/projects/lightweight-bracket/CONTEXT.md"
|
||||
],
|
||||
"confidence": "high",
|
||||
"notes": "Design plan is well-defined but all 7 requirement gaps (G1-G7) must be closed before FEA work can begin. The plan accounts for 7075-T6's lower ductility as a validation checkpoint.",
|
||||
"timestamp": "2026-02-16T12:56:30-05:00"
|
||||
}
|
||||
17
hq/handoffs/orch-1771275519-b51a1e44.json
Normal file
17
hq/handoffs/orch-1771275519-b51a1e44.json
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771275519-b51a1e44",
|
||||
"agent": "webster",
|
||||
"status": "complete",
|
||||
"result": "### Research on Delaunay Adaptive Isogrids (Variable Density Lattice Structures)\n\n**Summary:**\nThe term 'Delaunay adaptive isogrid' refers to what is more commonly known in recent academic literature as **variable density lattice structures** or **functionally graded lattice structures**. These are advanced materials created through topology optimization, where the density of the lattice/grid varies based on the local stress distribution. High-stress areas are reinforced with a denser structure, while low-stress areas are made sparser to save weight. The 'Delaunay' aspect likely refers to the use of Delaunay triangulation or its dual, Voronoi tessellation, as a method to generate the final grid geometry from a point cloud derived from the optimization's density map.\n\n**Algorithms & Implementation:**\n\n1. **Topology Optimization Core:** The process begins with a topology optimization algorithm, typically **SIMP (Solid Isotropic Material with Penalization)**. The design space is discretized into voxels, and the algorithm iteratively assigns a 'pseudo-density' to each voxel, effectively removing material from areas of low stress to meet a weight target while maximizing stiffness.\n\n2. **Lattice Property Modeling:** For the optimization to be accurate, the mechanical properties of the lattice at various densities must be modeled. Recent approaches include:\n * **Asymptotic Homogenization:** A method to compute the effective elastic properties of the lattice material.\n * **Representative Volume Element (RVE):** A more computationally intensive but accurate method that simulates a small, representative sample of the lattice to determine its properties.\n\n3. **Lattice Generation:** The resulting pseudo-density map is translated into a physical structure. A common method is to generate a point cloud where the point density corresponds to the material density map, and then use **Delaunay triangulation or Voronoi tessellation** to create the final interconnected grid structure.\n\n**Implementation Trade-offs:**\n\n* **Manufacturability vs. Optimal Design:** The theoretically perfect design from a pure FEA standpoint is often impossible to manufacture. A key trade-off involves incorporating **Additive Manufacturing (AM)** constraints directly into the algorithm. Recent research highlights filters that ensure the geometry is **self-supporting** during the build process, preventing collapses and managing overhangs.\n* **Computational Cost vs. Accuracy:** Simple power-law models for lattice properties are fast but less accurate. RVE and homogenization methods provide higher fidelity at the cost of significantly increased computation time.\n* **Stress vs. Stiffness:** The optimization objective can be set to either minimize compliance (maximize stiffness) or to keep stress levels below a certain threshold to prevent failure. These two objectives can result in different final topologies.\n\n**Recent Papers & Trends (Last 5 Years):**\n\n* A significant trend is the tight integration of **AM constraints** into the optimization process, moving beyond pure mathematical optimization to design for manufacturability (DFAM).\n* Research focuses on improving the fidelity of **material property modeling** for these graded structures, as this is key to producing reliable and predictable parts.\n* Application-focused studies demonstrate the use of these techniques on real-world components, particularly in aerospace, to achieve significant weight reduction (e.g., 20-30%) while maintaining or even improving mechanical performance.",
|
||||
"deliverable": {
|
||||
"type": "analysis",
|
||||
"title": "Research on Delaunay Adaptive Isogrid for Structural Optimization",
|
||||
"path": null,
|
||||
"summary": "A summary of algorithms, trade-offs, and recent papers concerning the structural optimization technique known as variable density or graded lattice structures."
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "The search term 'Delaunay adaptive isogrid' is not the standard academic term. The research was conducted using the more common terms 'variable density lattice structure' and 'graded lattice structure' which describe the same concept.",
|
||||
"timestamp": "2026-02-16T15:59:53.649-05:00"
|
||||
}
|
||||
17
hq/handoffs/orch-1771275609-d6136ddd.json
Normal file
17
hq/handoffs/orch-1771275609-d6136ddd.json
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771275609-d6136ddd",
|
||||
"agent": "tech-lead",
|
||||
"status": "complete",
|
||||
"result": "## Technical Readiness Assessment: Variable Density Lattice Structures\n\n### Research Quality\nWebster's research is solid at a survey level. The key insight — that 'Delaunay adaptive isogrid' maps to the well-established field of graded lattice structures — is correct and important. It means we're not chasing a niche technique; there's a mature body of work to draw from.\n\n### Our Readiness: MEDIUM-LOW\n\n**What we have:**\n- Strong FEA/optimization foundation (SOL 200, topology optimization experience)\n- Atomizer's LAC framework can handle parametric sweeps and result extraction\n- NX/Simcenter toolchain with lattice structure support in newer versions\n\n**What we lack:**\n1. **Homogenization expertise** — Mapping lattice unit cell properties to continuum-level material cards is non-trivial. We'd need to build or validate RVE models for each cell topology we want to use.\n2. **AM process knowledge** — Self-supporting constraints, overhang angles, minimum feature sizes are manufacturing-specific. Without a target AM process and machine, optimization is academic.\n3. **Lattice meshing pipeline** — Going from a density field to an actual lattice geometry that can be meshed and validated is a significant toolchain gap. NX has some capability here but we haven't exercised it.\n4. **Validation data** — No test specimens, no correlation between predicted and actual lattice performance.\n\n### Key Challenges\n1. **Computational cost** — Graded lattice optimization with homogenization is expensive. Our current compute setup (single workstation) may be a bottleneck for anything beyond small components.\n2. **Two-scale problem** — The macro-level optimization and micro-level lattice behavior are coupled. Getting this right requires careful methodology.\n3. **Post-processing** — Extracting meaningful stress/strain results from lattice structures requires different approaches than solid elements.\n\n### Recommended First Steps\n1. **Scope a pilot problem** — Pick a simple bracket or plate with known loading. Run standard topology optimization first, then attempt lattice infill using NX's built-in tools. This tests the toolchain without custom code.\n2. **Build one RVE model** — Take a single unit cell (e.g., BCC or octet-truss), model it in detail, extract effective properties via homogenization. This builds the foundational skill.\n3. **Define the AM target** — We cannot optimize for manufacturability without knowing the process (SLM, EBM, DLP?) and material. This is a business decision that gates technical work.\n4. **Literature deep-dive on homogenization** — Specifically Hashin-Shtrikman bounds and asymptotic homogenization for lattices. This is the theory we need.\n\n### Bottom Line\nThe technology is mature in academia but implementing it properly requires filling real gaps in our pipeline — especially homogenization, AM constraints, and lattice geometry generation. I recommend a 2-3 week pilot study on a simple component before committing to any client work involving graded lattices.",
|
||||
"deliverable": {
|
||||
"type": "analysis",
|
||||
"title": "Readiness Assessment: Variable Density Lattice Structures",
|
||||
"path": null,
|
||||
"summary": "Assessment of team readiness to implement graded lattice optimization, identifying gaps and recommending a pilot study approach."
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "Assessment assumes current NX/Simcenter toolchain and single-workstation compute. Readiness level would change significantly if we partner with an AM shop or acquire lattice-specific software (e.g., nTopology).",
|
||||
"timestamp": "2026-02-16T16:00:45.000-05:00"
|
||||
}
|
||||
17
hq/handoffs/orch-1771288051-2d112738.json
Normal file
17
hq/handoffs/orch-1771288051-2d112738.json
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771288051-2d112738",
|
||||
"agent": "tech-lead",
|
||||
"status": "complete",
|
||||
"result": "## Analytical Heat Sink Thermal Analysis\n\n### Given\n- 4 rectangular fins on 50mm × 50mm base\n- Fin height: 25mm, thickness: 1mm, span: 50mm\n- AL6061-T6: k = 167 W/m·K\n- h = 10 W/m²·K (natural convection), Q = 10W, T_amb = 25°C\n\n### Fin Efficiency\n- Fin parameter: m = √(2h/kt) = √(2×10 / 167×0.001) = √119.76 = 10.94 m⁻¹\n- Corrected fin length (accounts for tip): Lc = L + t/2 = 0.025 + 0.0005 = 0.0255 m\n- mLc = 10.94 × 0.0255 = 0.279\n- **η = tanh(mLc) / mLc = 0.2738 / 0.279 = 0.981 (98.1%)**\n\nThe high efficiency is expected — thin aluminum fins with modest convection yield a nearly isothermal fin.\n\n### Surface Areas\n- Per fin (including tip via corrected length): 2 × 0.0255 × 0.05 = 0.00255 m²\n- Total fin area (4 fins): 4 × 0.00255 = 0.01020 m²\n- Unfinned base area: 0.05² − 4×(0.001×0.05) = 0.0025 − 0.0002 = 0.0023 m²\n- Effective convective area: η·A_fin + A_unfinned = 0.981×0.01020 + 0.0023 = 0.01231 m²\n\n### Thermal Resistance\n- **R_conv = 1 / (h · A_eff) = 1 / (10 × 0.01231) = 8.12 °C/W**\n- Base conduction resistance neglected (base thickness not specified; for typical 2-5mm AL6061 base it would add < 0.01 °C/W — negligible)\n\n### Base Temperature\n- **T_base = T_amb + Q · R_total = 25 + 10 × 8.12 = 106.2°C**\n\n### Summary Table\n| Parameter | Value |\n|-----------|-------|\n| Fin efficiency (η) | 98.1% |\n| Thermal resistance (R) | 8.12 °C/W |\n| Base temperature | 106.2°C |\n| Max fin tip temperature | ~104.9°C (η≈0.981 means ~1.3°C gradient along fin) |\n\n### Notes\n- With only 4 fins the total convective area is small, resulting in high thermal resistance. For lower base temperature, increase fin count (e.g., 10-12 fins with ~3mm spacing would roughly halve R).\n- Natural convection h=10 W/m²·K is reasonable for vertical plates in still air. Actual h depends on orientation and fin spacing (chimney effect).\n- Base conduction spreading resistance is negligible for this geometry but should be checked if heat source is localized.",
|
||||
"deliverable": {
|
||||
"type": "analysis",
|
||||
"title": "4-Fin Heat Sink Analytical Thermal Solution",
|
||||
"path": null,
|
||||
"summary": "Fin efficiency 98.1%, thermal resistance 8.12 °C/W, base temperature 106.2°C for 10W load with natural convection"
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "Classical extended surface (fin) theory used with corrected fin length for tip convection. Base conduction resistance neglected (not specified). Results are for uniform h assumption; real natural convection h varies with fin spacing and orientation.",
|
||||
"timestamp": "2026-02-16T19:27:00-05:00"
|
||||
}
|
||||
17
hq/handoffs/orch-1771288093-0a80a997.json
Normal file
17
hq/handoffs/orch-1771288093-0a80a997.json
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771288093-0a80a997",
|
||||
"agent": "secretary",
|
||||
"status": "complete",
|
||||
"result": "📋 **Orchestration Report — 4-Fin Heat Sink Thermal Analysis**\n📅 2026-02-16\n\n**What happened:**\nThe Technical Lead performed an analytical thermal study on a 4-fin heat sink design under natural convection to assess its performance with a 10W heat load.\n\n**Key findings:**\n- 🔴 **High Temperature:** The heat sink base is predicted to reach **106.2°C**, which is high for many electronic applications.\n- 🟡 **High Resistance:** The thermal resistance is **8.12 °C/W**, caused by the limited surface area from having only four fins.\n- 🟢 **High Fin Efficiency:** Individual fins are highly effective (**98.1% efficiency**), indicating the core limitation is not fin performance but the low fin count.\n\n**Decisions made:**\n- **Recommendation:** To significantly lower the base temperature, the fin count should be increased. The analysis suggests that using 10-12 fins could roughly halve the thermal resistance.\n\n**Deliverables:**\n- 📄 Summary Report: 4-Fin Heat Sink Thermal Analysis → Self-contained in this message.\n\n**Status:** ✅ Complete\n\n**Next steps:**\n- Awaiting review on whether to proceed with a design revision to increase the fin count.",
|
||||
"deliverable": {
|
||||
"type": "document",
|
||||
"title": "Summary Report: 4-Fin Heat Sink Thermal Analysis",
|
||||
"path": null,
|
||||
"summary": "A 1-page summary of the heat sink analysis, highlighting a high base temperature of 106.2°C and recommending an increased fin count."
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "Report generated based on the analytical solution provided by the Tech Lead. The deliverable is the formatted summary for the #reports channel.",
|
||||
"timestamp": "2026-02-16T19:28:30-05:00"
|
||||
}
|
||||
19
hq/handoffs/orch-1771289750-8a0c6163.json
Normal file
19
hq/handoffs/orch-1771289750-8a0c6163.json
Normal file
@@ -0,0 +1,19 @@
|
||||
```json
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771289750-8a0c6163",
|
||||
"agent": "webster",
|
||||
"status": "complete",
|
||||
"result": "## NXOpen Python: Symmetric Extrusion\n\nThis Python code snippet, designed for use within a Siemens NX environment, demonstrates how to perform a symmetric extrusion on a pre-existing sketch.\n\n### Python Code\n\n```python\nimport NXOpen\nimport NXOpen.Features\nimport NXOpen.GeometricUtilities\n\ndef main():\n # Get the current session and work part\n theSession = NXOpen.Session.GetSession()\n workPart = theSession.Parts.Work\n theUI = NXOpen.UI.GetUI()\n\n # Find the sketch by name\n sketchName = 'ISOGRID_RIB_sandbox_1'\n sketch = None\n for s in workPart.Sketches:\n if s.Name == sketchName:\n sketch = s\n break\n\n if sketch is None:\n theUI.NXMessageBox.Show(\"Error\", NXOpen.NXMessageBox.DialogType.Error, f\"Sketch '{sketchName}' not found.\")\n return\n\n # 1. Create an ExtrudeBuilder\n extrudeBuilder = workPart.Features.CreateExtrudeBuilder(NXOpen.Features.Feature.Null)\n\n # 2. Set the section for extrusion\n section = workPart.Sections.CreateSection(0.0095, 0.01, 0.5)\n extrudeBuilder.Section = section\n extrudeBuilder.AllowSelfIntersectingSection(True)\n\n # Define the extrusion direction (using sketch normal)\n direction = NXOpen.Vector3d(0.0, 0.0, 1.0) # Default Z-axis\n if sketch.Normal is not None:\n direction = sketch.Normal\n extrudeBuilder.Direction = direction\n\n # Add the sketch curves to the section\n scRule = workPart.ScRuleFactory.CreateRuleSketch(sketch)\n rules = [scRule]\n extrudeBuilder.Section.AddFromRule(scRule)\n\n # 3. Set symmetric extrusion limits\n # The key to a symmetric extrusion is setting both the start and end distance.\n extrudeBuilder.Limits.StartExtend.Value.RightHandSide = \"10\"\n extrudeBuilder.Limits.EndExtend.Value.RightHandSide = \"10\"\n # A symmetric extrusion is implicitly created by having non-zero start and end values.\n # For clarity, one could express the start as a negative value in some contexts,\n # but setting both end values achieves the symmetric result relative to the sketch plane.\n\n # Set boolean operation type (e.g., Unite, Subtract, Intersect)\n extrudeBuilder.BooleanOption.Type = NXOpen.GeometricUtilities.BooleanOperation.BooleanType.Unite\n\n # 4. Commit the feature\n feature = extrudeBuilder.Commit()\n\n # 5. Clean up the builder\n extrudeBuilder.Destroy()\n\nif __name__ == '__main__':\n main()\n\n```\n\n### Explanation\n\n1. **`CreateExtrudeBuilder`**: This function from the `workPart.Features` collection instantiates a builder object, which is used to define all the parameters of the extrusion feature before it is created.\n\n2. **`Section`**: The `extrudeBuilder.Section` property is assigned a new `Section` object. This section acts as a container for the geometry that will be extruded. The sketch `ISOGRID_RIB_sandbox_1` is added to this section using a `ScRuleFactory` (Smart Collector Rule Factory) which is the standard way to select entire sketches.\n\n3. **`Limits`**: This is the most critical part for a symmetric extrusion. The `extrudeBuilder.Limits` object has `StartExtend` and `EndExtend` properties. By setting the `Value` of both to \"10\", we instruct NX to extrude 10mm in one direction from the sketch plane and 10mm in the opposite direction, resulting in a total extrusion depth of 20mm, centered on the sketch.\n\n4. **`Commit`**: This method finalizes the builder's parameters and creates the actual `Extrude` feature in the model history.\n\n5. **`Destroy`**: After the feature is created, the builder object is no longer needed and is destroyed to free up resources.",
|
||||
"deliverable": {
|
||||
"type": "code",
|
||||
"title": "NXOpen Python Snippet for Symmetric Extrusion",
|
||||
"path": null,
|
||||
"summary": "A Python script using the nxopen module to perform a 10mm symmetric extrusion on a specified sketch."
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "The provided code assumes it is run within an active NX session where a part is loaded and contains a sketch with the specified name. The boolean operation is set to 'Unite' by default, which may need to be changed depending on the desired interaction with existing bodies.",
|
||||
"timestamp": "2026-02-17T00:55:54.015Z"
|
||||
}
|
||||
```
|
||||
17
hq/handoffs/orch-1771294413-f420d995.json
Normal file
17
hq/handoffs/orch-1771294413-f420d995.json
Normal file
@@ -0,0 +1,17 @@
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-1771294413-f420d995",
|
||||
"agent": "tech-lead",
|
||||
"status": "complete",
|
||||
"result": "## Adaptive Isogrid vs. Traditional Topology Optimization\n\n### 1. Manufacturability by Construction\nTopology optimization (SIMP/level-set) produces organic, free-form material distributions that require extensive post-processing to become manufacturable—often losing 10-30% of the theoretical optimum during interpretation. The adaptive isogrid method generates manufacturing-ready geometry (ribs, pockets, fillets, keepouts) *directly*. Every trial output is waterjet/CNC-feasible without human cleanup.\n\n### 2. Parametric Interpretability\nTopology optimization yields a density field that must be thresholded and interpreted—a lossy, subjective step. The isogrid approach operates on 15 physically meaningful parameters (rib thickness, cell spacing, influence radii, frame width, fillet radius). Engineers can inspect, understand, and manually adjust any result. The design space is transparent.\n\n### 3. Stable FEA Loop\nTopology optimization typically requires penalized intermediate densities (SIMP) or evolving boundaries (level-set), both demanding specialized solvers or filtering. The isogrid method uses standard shell FEA on a concrete geometry every iteration—no artificial material models, no checkerboarding, no mesh-dependency filtering. The reserved-region architecture keeps loads/BCs stable across iterations.\n\n### 4. Deterministic Geometry Transfer\nThe JSON-only round-trip (Python → NX) is deterministic and lossless. Topology optimization results typically require STEP/STL export, smoothing, defeaturing, and reimport—each step introducing geometric drift.\n\n### 5. Scalable Optimization with Atomizer/Optuna\nWith 15 continuous parameters, Optuna TPE builds an efficient surrogate in ~200-500 trials. Traditional topology optimization is a single monolithic solve (or expensive multi-start). The parametric formulation naturally supports:\n- Multi-objective extension (mass vs. stiffness vs. frequency)\n- Constraint handling via penalty functions\n- History tracking and convergence monitoring\n- Easy parameter bound updates based on manufacturing feedback\n\n### 6. Feature Preservation\nHole keepouts, edge frames, and reserved regions are *architectural primitives*, not post-hoc constraints. Topology optimization struggles with bolt-hole reinforcement patterns and edge features unless complex manufacturing constraints are coded into the optimizer.\n\n### 7. V2 Extensibility\nThe stress-feedback loop (v2) adds structural adaptation on top of geometric adaptation—combining the best of both worlds: engineer-controlled topology (isogrid) with FEA-driven local refinement, without abandoning manufacturability.\n\n### Key Trade-off\nThe isogrid method restricts the design space to triangulated rib patterns rather than exploring all possible topologies. This means it won't discover radically non-intuitive load paths. However, for plate lightweighting applications (the target domain), isogrid patterns are near-optimal by classical theory (NASA CR-124075), so the restricted space loses little while gaining full manufacturability.",
|
||||
"deliverable": {
|
||||
"type": "analysis",
|
||||
"title": "Adaptive Isogrid vs. Topology Optimization Comparison",
|
||||
"path": null,
|
||||
"summary": "Concise comparison of adaptive isogrid method advantages over traditional topology optimization when paired with Atomizer."
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "Analysis based on the provided technical specification and general FEA/optimization knowledge. The key trade-off (restricted design space) is noted for completeness.",
|
||||
"timestamp": "2026-02-17T02:13:00Z"
|
||||
}
|
||||
18
hq/handoffs/orch-isogrid-test-01-webster.json
Normal file
18
hq/handoffs/orch-isogrid-test-01-webster.json
Normal file
@@ -0,0 +1,18 @@
|
||||
|
||||
{
|
||||
"schemaVersion": "1.1",
|
||||
"runId": "orch-isogrid-test-01-webster",
|
||||
"agent": "webster",
|
||||
"status": "complete",
|
||||
"result": "### State-of-the-Art: Isogrid/Stiffened Panel Topology Optimization\n\n**1. Parametric Pattern Generation Methods:**\nThe current trend moves beyond rigid triangular or hexagonal patterns towards more organic, free-form stiffener layouts generated by advanced parametric techniques. The state-of-the-art centers on methods like the Parametric Level Set Method (PLSM) and spline-based (e.g., NURBS) representations. These approaches define complex rib topologies using a relatively small set of optimizable control parameters (e.g., spline control points, level set function coefficients). This allows the optimization algorithm to explore a much richer design space, creating ribs that align more effectively with principal stress paths, rather than being confined to a predefined grid topology. This results in more structurally efficient and lightweight designs.\n\n**2. Integration with FEA for Structural Validation:**\nIntegration between the parametric geometry engine and FEA solvers is fundamental to the optimization loop. The standard workflow involves programmatically generating the isogrid geometry based on a set of parameters, automatically meshing it (often with shell elements for the skin and beam or shell elements for the ribs), applying loads and boundary conditions, and running the FEA solver to evaluate performance metrics like stress, displacement, buckling load, and natural frequency. To mitigate the high computational cost of this iterative process, a key technique is the use of surrogate models (or response surfaces). Machine learning models (e.g., Gaussian Process Regression, Neural Networks) are trained on a limited set of high-fidelity FEA results to predict the structural performance for new parameter combinations, enabling much faster exploration of the design space by the optimizer.\n\n**3. Optimization using Optuna/Bayesian Methods:**\nFor high-dimensional parameter spaces (e.g., 15+ parameters), Bayesian optimization is the state-of-the-art, and Optuna is a leading framework for its implementation. Unlike grid search, Bayesian methods (specifically algorithms like Tree-structured Parzen Estimator or TPE, used by Optuna) are sample-efficient. They build a probabilistic model of the objective function and use an acquisition function to intelligently select the next set of parameters to evaluate. This process balances exploration (trying new, uncertain regions) and exploitation (refining known good regions), allowing the optimizer to converge on a high-performance design with significantly fewer expensive FEA calls. This is particularly effective for multi-objective problems, such as minimizing mass while maximizing stiffness and buckling resistance.\n\n**4. Practical Approaches to Hole/Boss Placement:**\nThe most effective modern approach is to incorporate holes, bosses, and other interface features as constraints within the optimization problem itself. This is handled by defining these areas as 'non-design' or 'frozen' regions within the design space. The parametric rib generation algorithm is then constrained to flow material around these keep-out zones (holes) or merge smoothly into the boundaries of keep-in zones (bosses or mounting pads). This constraint-driven method is superior to post-processing because it ensures that the optimized load paths are aware of and interact correctly with the fixed features, preventing stress concentrations and ensuring a more integrated final design.",
|
||||
"deliverable": {
|
||||
"type": "analysis",
|
||||
"title": "State-of-the-Art in Isogrid Topology Optimization",
|
||||
"path": null,
|
||||
"summary": "A concise analysis of current techniques in parametric generation, FEA integration, Bayesian optimization, and feature placement for isogrid structures."
|
||||
},
|
||||
"artifacts": [],
|
||||
"confidence": "high",
|
||||
"notes": "The research confirms the user's current tool stack (Python, Optuna, NX integration) is well-aligned with industry best practices. The key areas for advancement appear to be in the sophistication of the parametric generation method (e.g., moving towards level-set or free-form splines) and the use of surrogate models to accelerate the optimization loop.",
|
||||
"timestamp": "2026-02-16T08:35:56.242Z"
|
||||
}
|
||||
17
hq/handoffs/orch-isogrid-test-02-techlead.json
Normal file
17
hq/handoffs/orch-isogrid-test-02-techlead.json
Normal file
File diff suppressed because one or more lines are too long
17
hq/hq/MODEL-CHANGES-NEEDED.md
Normal file
17
hq/hq/MODEL-CHANGES-NEEDED.md
Normal file
@@ -0,0 +1,17 @@
|
||||
# MODEL-CHANGES-NEEDED
|
||||
|
||||
Do **not** apply automatically. These are required edits for gateway `config.patch`.
|
||||
|
||||
## Required model assignment changes
|
||||
|
||||
1. **optimizer**
|
||||
- Current: `anthropic/claude-opus-4-6`
|
||||
- Change to: `anthropic/claude-sonnet-4-5`
|
||||
|
||||
2. **secretary**
|
||||
- Current: `anthropic/claude-sonnet-4-5`
|
||||
- Change to: `google/gemini-2.5-flash`
|
||||
|
||||
## Rationale
|
||||
- Optimizer workload is mostly structured optimization planning/execution, better cost-efficiency on Sonnet 4.5.
|
||||
- Secretary workload is summarization/admin condensation, best fit and lowest cost on Flash.
|
||||
37
hq/hq/condensations/2026-02-16-isogrid-sota-review.md
Normal file
37
hq/hq/condensations/2026-02-16-isogrid-sota-review.md
Normal file
@@ -0,0 +1,37 @@
|
||||
## 📝 Orchestration Condensation: P-Adaptive-Isogrid State-of-the-Art Review
|
||||
**Date:** 2026-02-16
|
||||
**Participants:** Webster, Tech-Lead
|
||||
|
||||
### Context
|
||||
This document synthesizes a state-of-the-art (SOTA) review and an internal gap analysis for the P-Adaptive-Isogrid optimization tool. The goal was to identify critical gaps and prioritize improvements by comparing our current architecture to modern best practices in isogrid and stiffened panel optimization.
|
||||
|
||||
### Key Findings from State-of-the-Art Research (Webster)
|
||||
- **Parametric Generation:** Modern tools are moving beyond rigid triangular patterns to free-form stiffener layouts using methods like Parametric Level Set Method (PLSM) or NURBS splines. This allows ribs to align more naturally with principal stress paths.
|
||||
- **FEA Integration & Acceleration:** The standard workflow couples a parametric engine with an FEA solver. To manage computational cost, **surrogate models** (e.g., Gaussian Process, Neural Networks) are used to predict performance, drastically reducing the number of required high-fidelity FEA runs.
|
||||
- **Optimization Algorithms:** Bayesian optimization methods, particularly Tree-structured Parzen Estimator (TPE) as implemented in Optuna, are the SOTA for efficiently navigating high-dimensional parameter spaces.
|
||||
- **Feature Integration:** Holes, bosses, and keep-out zones are not post-processed. They are defined as constraints within the design space, allowing the optimizer to intelligently route load paths around them from the start.
|
||||
|
||||
### Gap Analysis & Recommendations (Tech-Lead)
|
||||
The Tech-Lead's review, based on the SOTA context, identified critical strengths, gaps, and risks in our current tool.
|
||||
|
||||
#### Strengths (What We Already Do Well)
|
||||
- ✅ **Solid Foundation:** Use of spatially-varying density fields, industry-standard Delaunay triangulation, and TPE for optimization is well-aligned with SOTA.
|
||||
- ✅ **Manufacturability:** Embedding manufacturing constraints (min rib width, fillet radii, keepout zones) is a key strength, putting the tool ahead of many academic counterparts.
|
||||
- ✅ **Robust Architecture:** The reserved-region AFEM architecture and JSON-only geometry transfer are robust design choices.
|
||||
|
||||
#### Critical Gaps (What We Are Missing)
|
||||
- ❌ **Buckling Blind Spot (HIGH RISK):** The current optimization objective checks only stress and displacement, completely ignoring buckling. This is the single biggest technical risk, as isogrids are often buckling-critical.
|
||||
- ❌ **No Topology Optimization Seeding:** The density field relies on heuristics, not on proven topology optimization methods (like SIMP/LSM) that could provide a more optimal starting point.
|
||||
- ❌ **Single-Objective Optimization:** The tool conflates mass, stress, and displacement into a single objective using arbitrary penalty weights. It lacks support for multi-objective optimization (e.g., NSGA-II) which would yield a Pareto front of choices for the engineer.
|
||||
- ❌ **Isotropic Density Field:** The density field is uniform in all directions, whereas real load paths are directional. Anisotropic density would produce more efficient structures.
|
||||
- ❌ **No Analytical Benchmarks:** The tool is not validated against classical solutions, such as those in the NASA CR-124075 isogrid handbook.
|
||||
|
||||
### Top 5 Prioritized Improvements
|
||||
1. **P1: Local Pocket Buckling Check (HIGH):** Add a cheap, analytical buckling check during geometry generation to flag or penalize designs prone to this primary failure mode.
|
||||
2. **P2: Principal Stress Direction Alignment (MEDIUM-HIGH):** Introduce an anisotropic term to the density field to align ribs with dominant load paths.
|
||||
3. **P3: Multi-Objective Support (MEDIUM):** Refactor the objective function to use Optuna's native multi-objective samplers, providing the engineer with a Pareto front.
|
||||
4. **P4: Analytical Benchmark Suite (MEDIUM):** Implement classical isogrid equations to provide an "efficiency ratio" for generated designs.
|
||||
5. **P5: Density Field Smoothing (LOW-MEDIUM):** Add a Gaussian smoothing pass to the density field to prevent sharp transitions that cause stress concentrations.
|
||||
|
||||
### Conclusion
|
||||
The P-Adaptive-Isogrid tool has a strong and modern foundation. However, it is critically undermined by a blind spot to buckling failure. The prioritized improvements, especially the immediate addition of a buckling check, are essential for the tool to produce safe and genuinely optimal designs. Adopting multi-objective optimization and validating against analytical benchmarks are the next steps to elevate it to a state-of-the-art solution.
|
||||
@@ -0,0 +1,20 @@
|
||||
## 📝 Condensation: Material Priority for Lightweight Bracket
|
||||
**Date:** 2026-02-16
|
||||
**Channel:** #decisions
|
||||
**Thread:** Material Priority for Lightweight Bracket
|
||||
**Participants:** Antoine, Manager, Secretary
|
||||
|
||||
### Context
|
||||
The Technical Lead completed a comparison of 6061-T6 and 7075-T6 aluminum alloys for a new lightweight bracket. A decision was needed on whether to prioritize structural performance or other factors like thermal management, weldability, and cost.
|
||||
|
||||
### Decision
|
||||
**Structural performance is the top priority.** The selected material will be **7075-T6**.
|
||||
|
||||
### Rationale
|
||||
Antoine's directive was to "prioritize structural!". This indicates that the weight-saving and strength characteristics of 7075-T6 are more critical to the project's success than the other manufacturing and thermal considerations.
|
||||
|
||||
### Action Items
|
||||
- [ ] Manager to direct the Technical Lead to proceed with 7075-T6 for the bracket design and analysis.
|
||||
|
||||
### Supersedes
|
||||
- None
|
||||
86
hq/hq/projects/lightweight-bracket/CONTEXT.md
Normal file
86
hq/hq/projects/lightweight-bracket/CONTEXT.md
Normal file
@@ -0,0 +1,86 @@
|
||||
# Lightweight Bracket — Project Context
|
||||
|
||||
**Created:** 2026-02-16
|
||||
**Status:** Design Phase
|
||||
**Owner:** Technical Lead
|
||||
|
||||
---
|
||||
|
||||
## Material Decision
|
||||
|
||||
| Property | Value |
|
||||
|----------|-------|
|
||||
| **Selected Material** | Al 7075-T6 |
|
||||
| **Decision Date** | 2026-02-16 |
|
||||
| **Decision By** | Antoine (CEO) |
|
||||
| **Rationale** | Prioritize structural performance / weight savings |
|
||||
|
||||
### 7075-T6 Key Properties
|
||||
- Density: 2.81 g/cm³
|
||||
- UTS: 572 MPa
|
||||
- Yield: 503 MPa
|
||||
- Elongation: ~11%
|
||||
- Thermal conductivity: 130 W/m·K
|
||||
- CTE: 23.2 µm/m·°C
|
||||
|
||||
### Rejected Alternative
|
||||
- 6061-T6 — better thermal conductivity, weldability, and cost, but lower strength-to-weight
|
||||
|
||||
---
|
||||
|
||||
## Design Requirements
|
||||
*(To be defined — awaiting detailed requirements from CEO/Manager)*
|
||||
|
||||
- [ ] Load cases (magnitude, type, direction)
|
||||
- [ ] Geometric envelope / mounting constraints
|
||||
- [ ] Displacement / stiffness targets
|
||||
- [ ] Fatigue / cycle life requirements
|
||||
- [ ] Manufacturing constraints (machining vs. additive)
|
||||
- [ ] Weight target
|
||||
|
||||
---
|
||||
|
||||
## Next Phase: Preliminary Design & Analysis Plan
|
||||
|
||||
### Phase 1 — Requirements & Baseline
|
||||
1. **Define load cases** — static, dynamic, thermal (if any)
|
||||
2. **Establish geometric envelope** — mounting points, clearances, interfaces
|
||||
3. **Set performance targets** — max displacement, stress margins, weight budget
|
||||
4. **Create baseline CAD geometry** in NX
|
||||
|
||||
### Phase 2 — FEA Baseline Analysis
|
||||
1. **Mesh** — CQUAD4/CHEXA (mesh convergence study required)
|
||||
2. **Boundary conditions** — match physical mounting (bolted? welded? pinned?)
|
||||
3. **SOL 101** linear static — baseline stress & displacement
|
||||
4. **SOL 103** modal — check natural frequencies vs. excitation environment
|
||||
5. **Validate** — analytical hand-calcs for sanity check
|
||||
|
||||
### Phase 3 — Design Optimization
|
||||
1. **Identify design variables** — wall thickness, rib placement, fillet radii, topology
|
||||
2. **Formulate optimization** — minimize mass, constrain stress (σ_y / FOS) and displacement
|
||||
3. **Topology optimization** (if applicable) — SOL 200 or Simcenter topology
|
||||
4. **Parametric study** — LAC pattern via Atomizer framework
|
||||
5. **Iterate** to converged optimum
|
||||
|
||||
### Phase 4 — Validation & Deliverables
|
||||
1. **Mesh convergence** confirmation on final design
|
||||
2. **Margin of safety** report (yield, ultimate, buckling if thin-walled)
|
||||
3. **Fatigue assessment** if cyclic loading present
|
||||
4. **Note on 7075-T6 ductility** — 11% elongation is moderate; flag any high-strain regions
|
||||
5. **Final report** with full documentation
|
||||
|
||||
---
|
||||
|
||||
## Open Questions / Gaps
|
||||
- [ ] **G1:** Bracket function — what does it support? What assembly?
|
||||
- [ ] **G2:** Load cases — not yet defined
|
||||
- [ ] **G3:** Geometric constraints — no envelope defined
|
||||
- [ ] **G4:** Manufacturing method — machining assumed, confirm
|
||||
- [ ] **G5:** Factor of safety requirements
|
||||
- [ ] **G6:** Any thermal loads? (7075-T6 lower conductivity noted as accepted trade-off)
|
||||
- [ ] **G7:** Fatigue/cycle life requirements
|
||||
|
||||
---
|
||||
|
||||
## Superseded Decisions
|
||||
- None
|
||||
46
hq/hq/taskboard.json
Normal file
46
hq/hq/taskboard.json
Normal file
@@ -0,0 +1,46 @@
|
||||
{
|
||||
"board": "atomizer-hq",
|
||||
"version": "1.0",
|
||||
"tasks": [
|
||||
{
|
||||
"id": "ATZ-001",
|
||||
"title": "Example: Material Trade Study for M2",
|
||||
"description": "Compare Zerodur Class 0 vs CCZ HS for M2/M3 mirrors",
|
||||
"status": "backlog",
|
||||
"priority": "high",
|
||||
"assignee": null,
|
||||
"project": "gigabit-m1",
|
||||
"created": "2026-02-18T20:00:00Z",
|
||||
"updated": "2026-02-18T20:00:00Z",
|
||||
"context": "M2/M3 mirrors need CTE < 0.01 ppm/K at operating temp. Budget constraint.",
|
||||
"subtasks": [
|
||||
{
|
||||
"id": "s1",
|
||||
"title": "Research material properties",
|
||||
"assignee": "webster",
|
||||
"done": false
|
||||
},
|
||||
{
|
||||
"id": "s2",
|
||||
"title": "Technical evaluation",
|
||||
"assignee": "tech-lead",
|
||||
"done": false
|
||||
},
|
||||
{
|
||||
"id": "s3",
|
||||
"title": "Quality review",
|
||||
"assignee": "auditor",
|
||||
"done": false
|
||||
},
|
||||
{
|
||||
"id": "s4",
|
||||
"title": "Summary report",
|
||||
"assignee": "secretary",
|
||||
"done": false
|
||||
}
|
||||
],
|
||||
"deliverables": [],
|
||||
"comments": []
|
||||
}
|
||||
]
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
{
|
||||
"8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0": {
|
||||
"deviceId": "8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0",
|
||||
"publicKey": "fejk4Um31-XMqj58QkHSPd4DepfwG1RfvAgc0pcioe8",
|
||||
"platform": "linux",
|
||||
"clientId": "cli",
|
||||
"clientMode": "cli",
|
||||
"role": "operator",
|
||||
"roles": [
|
||||
"operator"
|
||||
],
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "266c2f244dc4453cb621f7fe9b04c82b",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"createdAtMs": 1771083769964,
|
||||
"lastUsedAtMs": 1771211076766
|
||||
}
|
||||
},
|
||||
"createdAtMs": 1771083769964,
|
||||
"approvedAtMs": 1771083769964
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18812
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "266c2f244dc4453cb621f7fe9b04c82b",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771211076776
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAfejk4Um31+XMqj58QkHSPd4DepfwG1RfvAgc0pcioe8=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIP4KzGQVG2NLIN0Sn8qdfpJUP/+z11Su0LNLvqcucqdc\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771083769933
|
||||
}
|
||||
Binary file not shown.
@@ -1,244 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-auditor.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "google/gemini-2.5-pro"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Auditor",
|
||||
"workspace": "/home/papa/atomizer/workspaces/auditor",
|
||||
"model": "google/gemini-2.5-pro",
|
||||
"identity": {
|
||||
"name": "Atomizer Auditor",
|
||||
"theme": "Quality gatekeeper. Skeptical, thorough, direct. Reviews every deliverable. Has veto power.",
|
||||
"emoji": "\ud83d\udd0d"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@auditor",
|
||||
"@Auditor",
|
||||
"\ud83d\udd0d"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": false,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-auditor": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"token": "${DISCORD_TOKEN_AUDITOR}"
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18812,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18812",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-15T20:42:12.545Z",
|
||||
"lastNotifiedVersion": "2026.2.14",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "19df1a6af503f7540765d5640ca6f0c85cf7fdb32ec33ef029878f1f05e37827",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "4b9eec2c8b7d4bf880a482951f5791b7",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771115284656
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "19df1a6af503f7540765d5640ca6f0c85cf7fdb32ec33ef029878f1f05e37827",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAKs86bSka8YGeyRrzn1l/geS+LJTjgMzEPgNJLVilweM=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIKYgmW/aukhjZiBUmuV1gjFr7X4ccTW3eaEWPxgo02+1\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771115284433
|
||||
}
|
||||
@@ -1,29 +0,0 @@
|
||||
{
|
||||
"messages": {
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 8
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard"
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
},
|
||||
"wizard": {
|
||||
"lastRunAt": "2026-02-15T00:28:05.182Z",
|
||||
"lastRunVersion": "2026.2.12",
|
||||
"lastRunCommand": "doctor",
|
||||
"lastRunMode": "local"
|
||||
},
|
||||
"meta": {
|
||||
"lastTouchedVersion": "2026.2.12",
|
||||
"lastTouchedAt": "2026-02-15T00:28:05.243Z"
|
||||
}
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
{
|
||||
"84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33": {
|
||||
"deviceId": "84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33",
|
||||
"publicKey": "R9ckbOaTvIzdV4-JGOQjCFGdOh_cOJD1CD9jp0p7X7k",
|
||||
"platform": "linux",
|
||||
"clientId": "cli",
|
||||
"clientMode": "cli",
|
||||
"role": "operator",
|
||||
"roles": [
|
||||
"operator"
|
||||
],
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "97dc1fe3641742f5923fe7c5ede21751",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"createdAtMs": 1771083738383,
|
||||
"lastUsedAtMs": 1771177015735
|
||||
}
|
||||
},
|
||||
"createdAtMs": 1771083738383,
|
||||
"approvedAtMs": 1771083738383
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18800
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "97dc1fe3641742f5923fe7c5ede21751",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771177015752
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAR9ckbOaTvIzdV4+JGOQjCFGdOh/cOJD1CD9jp0p7X7k=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIHAPhhhmTzddtgLJyJtUn82Bxp9ZuELCR73f0DNmgBIf\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771083738340
|
||||
}
|
||||
Binary file not shown.
@@ -1,340 +0,0 @@
|
||||
{
|
||||
"meta": {
|
||||
"lastTouchedVersion": "2026.2.12",
|
||||
"lastTouchedAt": "2026-02-15T02:04:34.030Z"
|
||||
},
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "google/gemini-2.5-pro"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"heartbeat": {
|
||||
"every": "0m"
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Manager",
|
||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
||||
"model": "google/gemini-2.5-pro",
|
||||
"identity": {
|
||||
"name": "Atomizer Manager",
|
||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
||||
"emoji": "\ud83c\udfaf"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@manager",
|
||||
"@Manager",
|
||||
"\ud83c\udfaf"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"token": "MTQ3MTg2NTQ3OTA1MTM0NjAwMw.GfLrsO.Ksikd8xoXQjtO7XcBCKRSA7wnaDzDdSPsfv6SY",
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-manager": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"slack": {
|
||||
"mode": "socket",
|
||||
"webhookPath": "/slack/events",
|
||||
"enabled": true,
|
||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
||||
"userTokenReadOnly": true,
|
||||
"allowBots": false,
|
||||
"requireMention": false,
|
||||
"groupPolicy": "allowlist",
|
||||
"historyLimit": 50,
|
||||
"reactionNotifications": "all",
|
||||
"thread": {
|
||||
"historyScope": "thread",
|
||||
"inheritParent": true
|
||||
},
|
||||
"actions": {
|
||||
"reactions": true,
|
||||
"messages": true,
|
||||
"pins": true,
|
||||
"memberInfo": true,
|
||||
"emojiList": true
|
||||
},
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"U0AE3J9MDND"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"C0AEJV13TEU": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0ADJALL61Z": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AD9F7LYNB": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AE4CESCC9": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AEB39CE5U": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18800,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18800",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
},
|
||||
"slack": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"models": {
|
||||
"providers": {
|
||||
"google": {
|
||||
"baseUrl": "https://generativelanguage.googleapis.com/v1beta",
|
||||
"apiKey": "AIzaSyBtzXpScWuTYWxkuFJNiAToRFH_L0r__Bg",
|
||||
"api": "google-generative-ai",
|
||||
"models": [
|
||||
{
|
||||
"id": "gemini-2.5-pro",
|
||||
"name": "Gemini 2.5 Pro",
|
||||
"reasoning": true,
|
||||
"input": [
|
||||
"text",
|
||||
"image"
|
||||
],
|
||||
"contextWindow": 1048576,
|
||||
"maxTokens": 65536
|
||||
},
|
||||
{
|
||||
"id": "gemini-2.5-flash",
|
||||
"name": "Gemini 2.5 Flash",
|
||||
"reasoning": true,
|
||||
"input": [
|
||||
"text",
|
||||
"image"
|
||||
],
|
||||
"contextWindow": 1048576,
|
||||
"maxTokens": 65536
|
||||
}
|
||||
]
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,304 +0,0 @@
|
||||
{
|
||||
"meta": {
|
||||
"lastTouchedVersion": "2026.2.12",
|
||||
"lastTouchedAt": "2026-02-15T01:07:40.257Z"
|
||||
},
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "anthropic/claude-opus-4-6"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Manager",
|
||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
||||
"model": "anthropic/claude-opus-4-6",
|
||||
"identity": {
|
||||
"name": "Atomizer Manager",
|
||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
||||
"emoji": "\ud83c\udfaf"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@manager",
|
||||
"@Manager",
|
||||
"\ud83c\udfaf"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"token": "MTQ3MTg2NTQ3OTA1MTM0NjAwMw.GfLrsO.Ksikd8xoXQjtO7XcBCKRSA7wnaDzDdSPsfv6SY",
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-manager": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"slack": {
|
||||
"mode": "socket",
|
||||
"webhookPath": "/slack/events",
|
||||
"enabled": true,
|
||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
||||
"userTokenReadOnly": true,
|
||||
"allowBots": false,
|
||||
"requireMention": false,
|
||||
"groupPolicy": "allowlist",
|
||||
"historyLimit": 50,
|
||||
"reactionNotifications": "all",
|
||||
"thread": {
|
||||
"historyScope": "thread",
|
||||
"inheritParent": true
|
||||
},
|
||||
"actions": {
|
||||
"reactions": true,
|
||||
"messages": true,
|
||||
"pins": true,
|
||||
"memberInfo": true,
|
||||
"emojiList": true
|
||||
},
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"U0AE3J9MDND"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"C0AEJV13TEU": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0ADJALL61Z": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AD9F7LYNB": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AE4CESCC9": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AEB39CE5U": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18800,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18800",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
},
|
||||
"slack": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,282 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "openai-codex/gpt-5.3-codex"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Manager",
|
||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
||||
"model": "openai-codex/gpt-5.3-codex",
|
||||
"identity": {
|
||||
"name": "Atomizer Manager",
|
||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
||||
"emoji": "\ud83c\udfaf"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@manager",
|
||||
"@Manager",
|
||||
"\ud83c\udfaf"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"token": "${DISCORD_TOKEN_MANAGER}",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"slack": {
|
||||
"mode": "socket",
|
||||
"webhookPath": "/slack/events",
|
||||
"enabled": true,
|
||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
||||
"userTokenReadOnly": true,
|
||||
"allowBots": false,
|
||||
"requireMention": false,
|
||||
"groupPolicy": "allowlist",
|
||||
"historyLimit": 50,
|
||||
"reactionNotifications": "all",
|
||||
"thread": {
|
||||
"historyScope": "thread",
|
||||
"inheritParent": true
|
||||
},
|
||||
"actions": {
|
||||
"reactions": true,
|
||||
"messages": true,
|
||||
"pins": true,
|
||||
"memberInfo": true,
|
||||
"emojiList": true
|
||||
},
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"U0AE3J9MDND"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"C0AEJV13TEU": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0ADJALL61Z": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AD9F7LYNB": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AE4CESCC9": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AEB39CE5U": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18800,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18800",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
},
|
||||
"slack": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"meta": {
|
||||
"lastTouchedVersion": "2026.2.12",
|
||||
"lastTouchedAt": "2026-02-14T16:38:57.436Z"
|
||||
}
|
||||
}
|
||||
@@ -1,222 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "anthropic/claude-opus-4-6"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Manager",
|
||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
||||
"model": "anthropic/claude-opus-4-6",
|
||||
"identity": {
|
||||
"name": "Atomizer Manager",
|
||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
||||
"emoji": "\ud83c\udfaf"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@manager",
|
||||
"@Manager",
|
||||
"\ud83c\udfaf"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"token": "${DISCORD_TOKEN_MANAGER}",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": false,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"ceo-office": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"slack": {
|
||||
"mode": "socket",
|
||||
"webhookPath": "/slack/events",
|
||||
"enabled": true,
|
||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
||||
"userTokenReadOnly": true,
|
||||
"allowBots": false,
|
||||
"requireMention": false,
|
||||
"groupPolicy": "allowlist",
|
||||
"historyLimit": 50,
|
||||
"reactionNotifications": "all",
|
||||
"thread": {
|
||||
"historyScope": "thread",
|
||||
"inheritParent": true
|
||||
},
|
||||
"actions": {
|
||||
"reactions": true,
|
||||
"messages": true,
|
||||
"pins": true,
|
||||
"memberInfo": true,
|
||||
"emojiList": true
|
||||
},
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"U0AE3J9MDND"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"C0AEJV13TEU": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0ADJALL61Z": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AD9F7LYNB": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AE4CESCC9": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"C0AEB39CE5U": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18800,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18800",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
},
|
||||
"slack": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 2,
|
||||
"runs": {}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-15T17:13:25.568Z",
|
||||
"lastNotifiedVersion": "2026.2.14",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18824
|
||||
@@ -1,244 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-nx-expert.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "anthropic/claude-sonnet-4-5"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer NX Expert",
|
||||
"workspace": "/home/papa/atomizer/workspaces/nx-expert",
|
||||
"model": "anthropic/claude-sonnet-4-5",
|
||||
"identity": {
|
||||
"name": "Atomizer NX Expert",
|
||||
"theme": "Siemens NX/CAD/CAE deep specialist.",
|
||||
"emoji": "\ud83d\udda5\ufe0f"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@nx-expert",
|
||||
"@NX Expert",
|
||||
"\ud83d\udda5\ufe0f"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": false,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-nx-expert": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"token": "${DISCORD_TOKEN_NX_EXPERT}"
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18824,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18824",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-14T13:54:45.783Z",
|
||||
"lastNotifiedVersion": "2026.2.13",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
{
|
||||
"b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd": {
|
||||
"deviceId": "b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd",
|
||||
"publicKey": "vBuKXBCdvM0VJ1yg9Mydmh7tQzEjic9L1GwhQ_w1Rrg",
|
||||
"platform": "linux",
|
||||
"clientId": "cli",
|
||||
"clientMode": "cli",
|
||||
"role": "operator",
|
||||
"roles": [
|
||||
"operator"
|
||||
],
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "d3ed19d5f143466db08fc47693ef1121",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"createdAtMs": 1771083768041,
|
||||
"lastUsedAtMs": 1771120758737
|
||||
}
|
||||
},
|
||||
"createdAtMs": 1771083768040,
|
||||
"approvedAtMs": 1771083768040
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18816
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "d3ed19d5f143466db08fc47693ef1121",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771120758747
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAvBuKXBCdvM0VJ1yg9Mydmh7tQzEjic9L1GwhQ/w1Rrg=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIOC89NY6pTuwDTSfHzB0okQdmEwSk3YKm51eYiBh+Jo0\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771083768008
|
||||
}
|
||||
Binary file not shown.
@@ -1,244 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-optimizer.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "anthropic/claude-sonnet-4-5"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Optimizer",
|
||||
"workspace": "/home/papa/atomizer/workspaces/optimizer",
|
||||
"model": "anthropic/claude-sonnet-4-5",
|
||||
"identity": {
|
||||
"name": "Atomizer Optimizer",
|
||||
"theme": "Optimization algorithm specialist. Data-driven, strategic, skeptical of too-good results.",
|
||||
"emoji": "\u26a1"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@optimizer",
|
||||
"@Optimizer",
|
||||
"\u26a1"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": false,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-optimizer": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"token": "${DISCORD_TOKEN_OPTIMIZER}"
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18816,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18816",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-14T13:54:41.272Z",
|
||||
"lastNotifiedVersion": "2026.2.13",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
{
|
||||
"5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3": {
|
||||
"deviceId": "5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3",
|
||||
"publicKey": "lNlX0xhSVQGvufMKYuLx1C2Ed0lS9uK22f6N4MmOoPU",
|
||||
"platform": "linux",
|
||||
"clientId": "cli",
|
||||
"clientMode": "cli",
|
||||
"role": "operator",
|
||||
"roles": [
|
||||
"operator"
|
||||
],
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "b6a85b3c2543407d846acb863d3d0545",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"createdAtMs": 1771113526822,
|
||||
"lastUsedAtMs": 1771121354308
|
||||
}
|
||||
},
|
||||
"createdAtMs": 1771113526821,
|
||||
"approvedAtMs": 1771113526821
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18808
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "b6a85b3c2543407d846acb863d3d0545",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771121354336
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAlNlX0xhSVQGvufMKYuLx1C2Ed0lS9uK22f6N4MmOoPU=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIBKcz+McFIShhev0zkU/2LDwcn76MtHqmA4dKZNXX4/d\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771113526792
|
||||
}
|
||||
Binary file not shown.
@@ -1,245 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-secretary.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "google/gemini-2.5-pro"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Secretary",
|
||||
"workspace": "/home/papa/atomizer/workspaces/secretary",
|
||||
"model": "google/gemini-2.5-pro",
|
||||
"identity": {
|
||||
"name": "Atomizer Secretary",
|
||||
"theme": "Executive assistant. Filters noise, summarizes, escalates what matters. Organized and proactive.",
|
||||
"emoji": "\ud83d\udccb"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@secretary",
|
||||
"@Secretary",
|
||||
"\ud83d\udccb"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-secretary": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"token": "${DISCORD_TOKEN_SECRETARY}",
|
||||
"allowBots": true
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18808,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18808",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 2,
|
||||
"runs": {}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-15T20:42:13.992Z",
|
||||
"lastNotifiedVersion": "2026.2.14",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
{
|
||||
"433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9": {
|
||||
"deviceId": "433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9",
|
||||
"publicKey": "B3KZQ84BJ7Kr8aJ_1NYsJUASfd95pfvxe3HMBnGYDnQ",
|
||||
"platform": "linux",
|
||||
"clientId": "cli",
|
||||
"clientMode": "cli",
|
||||
"role": "operator",
|
||||
"roles": [
|
||||
"operator"
|
||||
],
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "7e2455df825246b7b8f1832bbd610988",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"createdAtMs": 1771083773436,
|
||||
"lastUsedAtMs": 1771120695861
|
||||
}
|
||||
},
|
||||
"createdAtMs": 1771083773436,
|
||||
"approvedAtMs": 1771083773436
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18820
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "7e2455df825246b7b8f1832bbd610988",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771120695870
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAB3KZQ84BJ7Kr8aJ/1NYsJUASfd95pfvxe3HMBnGYDnQ=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIM3mdAQ/QFl9zqVyc2Lg/F8ZEJJc4219O2+0S6ynB+hB\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771083773401
|
||||
}
|
||||
Binary file not shown.
@@ -1,244 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-study-builder.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "anthropic/claude-sonnet-4-5"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Study Builder",
|
||||
"workspace": "/home/papa/atomizer/workspaces/study-builder",
|
||||
"model": "google/gemini-2.5-pro",
|
||||
"identity": {
|
||||
"name": "Atomizer Study Builder",
|
||||
"theme": "Meticulous study code engineer. Writes production-quality optimization scripts. Pattern-driven.",
|
||||
"emoji": "\ud83c\udfd7\ufe0f"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@study-builder",
|
||||
"@Study Builder",
|
||||
"\ud83c\udfd7\ufe0f"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": false,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-study-builder": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"token": "${DISCORD_TOKEN_STUDY_BUILDER}"
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18820,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18820",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-15T20:42:13.468Z",
|
||||
"lastNotifiedVersion": "2026.2.14",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"jobs": []
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
{
|
||||
"931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7": {
|
||||
"deviceId": "931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7",
|
||||
"publicKey": "7o6DeC6QPO2-Q1KFlXgeDVB2mvWhoBMd-W1OKJwd_pc",
|
||||
"platform": "linux",
|
||||
"clientId": "cli",
|
||||
"clientMode": "cli",
|
||||
"role": "operator",
|
||||
"roles": [
|
||||
"operator"
|
||||
],
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "7120ab625b624d8eb4cc0c7a6f1649dd",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"createdAtMs": 1771083760054,
|
||||
"lastUsedAtMs": 1771183873216
|
||||
}
|
||||
},
|
||||
"createdAtMs": 1771083760053,
|
||||
"approvedAtMs": 1771083760053
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{}
|
||||
@@ -1 +0,0 @@
|
||||
OPENCLAW_GATEWAY_PORT=18804
|
||||
@@ -1,16 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7",
|
||||
"tokens": {
|
||||
"operator": {
|
||||
"token": "7120ab625b624d8eb4cc0c7a6f1649dd",
|
||||
"role": "operator",
|
||||
"scopes": [
|
||||
"operator.admin",
|
||||
"operator.approvals",
|
||||
"operator.pairing"
|
||||
],
|
||||
"updatedAtMs": 1771183873219
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
{
|
||||
"version": 1,
|
||||
"deviceId": "931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7",
|
||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEA7o6DeC6QPO2+Q1KFlXgeDVB2mvWhoBMd+W1OKJwd/pc=\n-----END PUBLIC KEY-----\n",
|
||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIPmHG7m2/xG4CKlGz7ITTLtx8XZY9U3ba09nfjlNZnu7\n-----END PRIVATE KEY-----\n",
|
||||
"createdAtMs": 1771083760022
|
||||
}
|
||||
Binary file not shown.
@@ -1,246 +0,0 @@
|
||||
{
|
||||
"logging": {
|
||||
"level": "trace",
|
||||
"file": "/tmp/openclaw/atomizer-tech-lead.log",
|
||||
"redactSensitive": "tools"
|
||||
},
|
||||
"agents": {
|
||||
"defaults": {
|
||||
"model": {
|
||||
"primary": "anthropic/claude-opus-4-6"
|
||||
},
|
||||
"skipBootstrap": true,
|
||||
"bootstrapMaxChars": 25000,
|
||||
"userTimezone": "America/Toronto",
|
||||
"typingIntervalSeconds": 4,
|
||||
"typingMode": "instant",
|
||||
"maxConcurrent": 4,
|
||||
"subagents": {
|
||||
"maxConcurrent": 4
|
||||
},
|
||||
"compaction": {
|
||||
"mode": "safeguard",
|
||||
"memoryFlush": {
|
||||
"enabled": true
|
||||
}
|
||||
},
|
||||
"contextPruning": {
|
||||
"mode": "cache-ttl",
|
||||
"ttl": "15m",
|
||||
"keepLastAssistants": 3,
|
||||
"softTrimRatio": 0.6,
|
||||
"hardClearRatio": 0.8,
|
||||
"minPrunableToolChars": 2000
|
||||
}
|
||||
},
|
||||
"list": [
|
||||
{
|
||||
"id": "main",
|
||||
"default": true,
|
||||
"name": "Atomizer Tech Lead",
|
||||
"workspace": "/home/papa/atomizer/workspaces/technical-lead",
|
||||
"model": "anthropic/claude-opus-4-6",
|
||||
"identity": {
|
||||
"name": "Atomizer Tech Lead",
|
||||
"theme": "Deep FEA/optimization expert. Breaks down problems, leads R&D, reviews technical work. Rigorous and thorough.",
|
||||
"emoji": "\ud83d\udd27"
|
||||
},
|
||||
"groupChat": {
|
||||
"mentionPatterns": [
|
||||
"@tech-lead",
|
||||
"@technical-lead",
|
||||
"@Technical Lead",
|
||||
"\ud83d\udd27"
|
||||
]
|
||||
},
|
||||
"subagents": {
|
||||
"allowAgents": [
|
||||
"*"
|
||||
]
|
||||
}
|
||||
}
|
||||
]
|
||||
},
|
||||
"messages": {
|
||||
"responsePrefix": "[{identity.name}] ",
|
||||
"queue": {
|
||||
"mode": "collect",
|
||||
"debounceMs": 2000,
|
||||
"cap": 20
|
||||
},
|
||||
"inbound": {
|
||||
"debounceMs": 3000
|
||||
},
|
||||
"ackReaction": "",
|
||||
"ackReactionScope": "group-mentions"
|
||||
},
|
||||
"commands": {
|
||||
"native": "auto",
|
||||
"nativeSkills": "auto"
|
||||
},
|
||||
"hooks": {
|
||||
"enabled": true,
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
||||
"allowRequestSessionKey": true,
|
||||
"allowedSessionKeyPrefixes": [
|
||||
"agent:",
|
||||
"hook:"
|
||||
],
|
||||
"allowedAgentIds": [
|
||||
"*"
|
||||
]
|
||||
},
|
||||
"channels": {
|
||||
"discord": {
|
||||
"enabled": true,
|
||||
"commands": {
|
||||
"native": false
|
||||
},
|
||||
"groupPolicy": "allowlist",
|
||||
"dm": {
|
||||
"enabled": true,
|
||||
"policy": "allowlist",
|
||||
"allowFrom": [
|
||||
"719982779793932419"
|
||||
]
|
||||
},
|
||||
"guilds": {
|
||||
"1471858733452890132": {
|
||||
"requireMention": true,
|
||||
"users": [
|
||||
"719982779793932419"
|
||||
],
|
||||
"channels": {
|
||||
"general": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"ceo-office": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"announcements": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"daily-standup": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"technical": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"code-review": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"fea-analysis": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"nx-cad": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"task-board": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"meeting-notes": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"reports": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"research": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"science": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"active-projects": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"knowledge-base": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lessons-learned": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"agent-logs": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"inter-agent": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"it-ops": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"hydrotech-beam": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"lab": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"configuration-management": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
},
|
||||
"dl-tech-lead": {
|
||||
"allow": true,
|
||||
"requireMention": false
|
||||
},
|
||||
"project-dashboard": {
|
||||
"allow": true,
|
||||
"requireMention": true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"token": "${DISCORD_TOKEN_TECH_LEAD}",
|
||||
"allowBots": true
|
||||
}
|
||||
},
|
||||
"gateway": {
|
||||
"port": 18804,
|
||||
"mode": "local",
|
||||
"bind": "loopback",
|
||||
"auth": {
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
},
|
||||
"remote": {
|
||||
"url": "ws://127.0.0.1:18804",
|
||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
||||
}
|
||||
},
|
||||
"skills": {
|
||||
"load": {
|
||||
"extraDirs": [
|
||||
"/home/papa/atomizer/skills"
|
||||
]
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"entries": {
|
||||
"discord": {
|
||||
"enabled": true
|
||||
}
|
||||
}
|
||||
},
|
||||
"talk": {
|
||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
||||
}
|
||||
}
|
||||
@@ -1,4 +0,0 @@
|
||||
{
|
||||
"version": 2,
|
||||
"runs": {}
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
{
|
||||
"lastCheckedAt": "2026-02-14T13:58:06.883Z",
|
||||
"lastNotifiedVersion": "2026.2.13",
|
||||
"lastNotifiedTag": "latest"
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
{"signin":{"active_accounts_last_emitted":"13415642725926393"},"uninstall_metrics":{"installation_date2":"1771169125"},"user_experience_metrics":{"limited_entropy_randomization_source":"07B50ADFDCDA992431D7AE73C842EB3D","low_entropy_source3":3443,"provisional_client_id":"c97abc28-8817-4c37-95fe-e82e4bc69681","pseudo_low_entropy_source":5583,"stability":{"browser_last_live_timestamp":"13415642725922854"}}}
|
||||
@@ -1 +0,0 @@
|
||||
{"profile":{"info_cache":{"Default":{"default_avatar_fill_color":-47872,"default_avatar_stroke_color":-47872,"name":"openclaw","profile_color":"#FF4500","profile_color_seed":-47872,"profile_highlight_color":-47872,"shortcut_name":"openclaw","user_color":"#FF4500","user_name":"openclaw"}}},"signin":{"active_accounts_last_emitted":"13415642736020447"},"uninstall_metrics":{"installation_date2":"1771169136"},"user_experience_metrics":{"limited_entropy_randomization_source":"0A769CC3BC7D6B93E71DB6F6DB53BF3B","low_entropy_source3":7110,"provisional_client_id":"acfa085f-9288-4519-a5ca-e377359807ca","pseudo_low_entropy_source":3584,"stability":{"browser_last_live_timestamp":"13415642736015909"}},"variations_crash_streak":1}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user