Compare commits
53 Commits
fbbd3e7277
...
main
| Author | SHA1 | Date | |
|---|---|---|---|
| 2462356922 | |||
| 339754ca3c | |||
| b45896a391 | |||
| 4341215af2 | |||
| 540d97a7e1 | |||
| fcc716db95 | |||
| 4d09ce2a2e | |||
| f14cbfd6aa | |||
| cc683de192 | |||
| d17611eec0 | |||
| 075ad36221 | |||
| 4146e9d8f1 | |||
| f9373bee99 | |||
| 9b0769f3f4 | |||
| 11d212a476 | |||
| b3162aa78d | |||
| a069a9f21f | |||
| ae120c653e | |||
| 1b83159050 | |||
| c930728b1c | |||
| d299e168a3 | |||
| a6765d8a1f | |||
| 119011b420 | |||
| cf29e0aba5 | |||
| 1873e1865c | |||
| 25c415b52f | |||
| 6b17d73ef7 | |||
| 074632d0a9 | |||
| b448ca6268 | |||
| 2026572d91 | |||
| c7ef38282f | |||
| 1f58bb8016 | |||
| 31d21ec551 | |||
| 2b976cf872 | |||
| 39212aaf81 | |||
| 7acda7f55f | |||
| c59072eff2 | |||
| 176b75328f | |||
| 7eb3d11f02 | |||
| 6658de02f4 | |||
| a9c40368d3 | |||
| 98774453b3 | |||
| d8570eaa2d | |||
| 68a6b4763b | |||
| 8efa8ba0d1 | |||
| 6ed074dbbf | |||
| 5c63d877f0 | |||
| 906037f974 | |||
| 78f56a68b0 | |||
| 5cf994ec4b | |||
| 9bc3b12745 | |||
| 45d4c197ba | |||
| 8b9fc31bcd |
@@ -78,7 +78,10 @@
|
|||||||
"Skill(ralph-loop:ralph-loop)",
|
"Skill(ralph-loop:ralph-loop)",
|
||||||
"Skill(ralph-loop:ralph-loop:*)",
|
"Skill(ralph-loop:ralph-loop:*)",
|
||||||
"mcp__Claude_in_Chrome__computer",
|
"mcp__Claude_in_Chrome__computer",
|
||||||
"mcp__Claude_in_Chrome__navigate"
|
"mcp__Claude_in_Chrome__navigate",
|
||||||
|
"Bash(/c/Users/antoi/anaconda3/envs/atomizer/python.exe -m pip install:*)",
|
||||||
|
"Bash(/c/Users/antoi/anaconda3/envs/atomizer/python.exe tests/compare_triangle_vs_gmsh.py)",
|
||||||
|
"Bash(/c/Users/antoi/anaconda3/envs/atomizer/python.exe:*)"
|
||||||
],
|
],
|
||||||
"deny": [],
|
"deny": [],
|
||||||
"ask": []
|
"ask": []
|
||||||
|
|||||||
7
.gitignore
vendored
7
.gitignore
vendored
@@ -139,3 +139,10 @@ docs/generated/
|
|||||||
# Malformed filenames (Windows path used as filename)
|
# Malformed filenames (Windows path used as filename)
|
||||||
C:*
|
C:*
|
||||||
*.gitmodules
|
*.gitmodules
|
||||||
|
|
||||||
|
# project-context-sync (auto-generated, local only)
|
||||||
|
PROJECT_STATE.md
|
||||||
|
|
||||||
|
# Test results (synced via Syncthing, not git)
|
||||||
|
test_results/*.json
|
||||||
|
test_results/*.log
|
||||||
|
|||||||
21
.project-context.yml
Normal file
21
.project-context.yml
Normal file
@@ -0,0 +1,21 @@
|
|||||||
|
# project-context-sync configuration
|
||||||
|
# See: https://github.com/clawdbot/skills/project-context-sync
|
||||||
|
|
||||||
|
project_context:
|
||||||
|
# Use AI to generate smart summaries
|
||||||
|
# true: Rich context with inferred focus and suggestions (uses tokens)
|
||||||
|
# false: Raw git info only (fast, free)
|
||||||
|
ai_summary: true
|
||||||
|
|
||||||
|
# How many recent commits to show
|
||||||
|
recent_commits: 5
|
||||||
|
|
||||||
|
# Include file change stats in output
|
||||||
|
include_diff_stats: true
|
||||||
|
|
||||||
|
# Sections to include in PROJECT_STATE.md
|
||||||
|
sections:
|
||||||
|
- last_commit # Always included
|
||||||
|
- recent_changes # Recent commit list
|
||||||
|
- current_focus # AI-generated (requires ai_summary: true)
|
||||||
|
- suggested_next # AI-generated (requires ai_summary: true)
|
||||||
439
docs/DEV/ARSENAL-DEVELOPMENT-PLAN.md
Normal file
439
docs/DEV/ARSENAL-DEVELOPMENT-PLAN.md
Normal file
@@ -0,0 +1,439 @@
|
|||||||
|
# Arsenal Development Plan — Atomizer Multi-Solver Integration
|
||||||
|
|
||||||
|
> **Status:** DRAFT — pending CEO approval
|
||||||
|
> **Date:** 2026-06-25
|
||||||
|
> **Authors:** Technical Lead (architecture + feasibility), Auditor (risk + gates), Manager (orchestration)
|
||||||
|
> **Source docs:** Arsenal V3 Final, Tool-Agnostic Architecture, Multi-Solver Roadmap, Arsenal Reference
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 1. Executive Summary
|
||||||
|
|
||||||
|
**Goal:** Integrate the 80/20 highest-leverage open-source tools from the Atomizer Arsenal into V2, enabling fully scripted optimization without NX GUI dependency.
|
||||||
|
|
||||||
|
**What this unlocks:**
|
||||||
|
- Linux-headless optimization loops (no NX license bottleneck)
|
||||||
|
- 100s–1000s of trials per campaign (vs. current NX-constrained budgets)
|
||||||
|
- Multi-solver validation (CalculiX vs Nastran cross-checking)
|
||||||
|
- Path to CFD and multi-physics (expansion sprints)
|
||||||
|
|
||||||
|
**The 80/20 stack (6 sprints):**
|
||||||
|
|
||||||
|
| Priority | Tool | Category | Why |
|
||||||
|
|----------|------|----------|-----|
|
||||||
|
| 🔴 P1 | CalculiX | FEA solver | Free structural solver, covers 80% of use cases |
|
||||||
|
| 🔴 P1 | Gmsh | Meshing | Universal mesher, Python API, STEP import |
|
||||||
|
| 🔴 P1 | Build123d | CAD | Code-native geometry, LLM-perfect, headless |
|
||||||
|
| 🔴 P1 | meshio + pyNastran | Converters | Format glue between all tools |
|
||||||
|
| 🔴 P1 | PyVista + ParaView | Post-processing | Automated visualization pipeline |
|
||||||
|
| 🟡 P2 | pymoo | Optimization | Multi-objective (NSGA-II/III) |
|
||||||
|
| 🟡 P2 | OpenFOAM | CFD | Thermal/flow screening |
|
||||||
|
| 🟢 P3 | preCICE | Coupling | Thermo-structural coupling |
|
||||||
|
| 🟢 P3 | OpenMDAO | MDO | System-level optimization |
|
||||||
|
|
||||||
|
**Antoine's time commitment:** ~2–3 hours per sprint for validation gates.
|
||||||
|
**HQ autonomous work:** days of implementation per sprint.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 2. Architecture Overview
|
||||||
|
|
||||||
|
The Arsenal integrates through Atomizer's 3-layer tool-agnostic architecture:
|
||||||
|
|
||||||
|
```
|
||||||
|
┌─────────────────────────────────────────────────────────┐
|
||||||
|
│ Layer 3: OPTIMIZATION INTELLIGENCE │
|
||||||
|
│ AtomizerSpec v3.0 │ Optuna/pymoo │ LAC │ LLM Agents │
|
||||||
|
│ ── never touches tool-specific formats ── │
|
||||||
|
├─────────────────────────────────────────────────────────┤
|
||||||
|
│ Layer 2: TOOL PROCESSORS (deterministic Python) │
|
||||||
|
│ Geometry: nx_geometry │ build123d_geometry │ step_import│
|
||||||
|
│ Meshing: gmsh_mesher │ nx_mesher │
|
||||||
|
│ Solvers: nastran_solver │ calculix_solver │ openfoam │
|
||||||
|
│ Convert: meshio_converter │ pynastran_bridge │
|
||||||
|
│ Post: pyvista_post │ paraview_post │
|
||||||
|
├─────────────────────────────────────────────────────────┤
|
||||||
|
│ Layer 1: UNIVERSAL DATA CONTRACTS │
|
||||||
|
│ AtomizerGeometry │ AtomizerMesh │ AtomizerBCs │
|
||||||
|
│ AtomizerMaterial │ AtomizerResults │
|
||||||
|
│ ── solver-agnostic dataclasses (the Rosetta Stone) ── │
|
||||||
|
└─────────────────────────────────────────────────────────┘
|
||||||
|
```
|
||||||
|
|
||||||
|
**Key rule:** Adding a new tool = writing ONE processor file. Contracts never change per tool.
|
||||||
|
|
||||||
|
### 2.1 V2 Repository Target Layout
|
||||||
|
|
||||||
|
```
|
||||||
|
atomizer/
|
||||||
|
├── contracts/
|
||||||
|
│ ├── geometry.py # AtomizerGeometry
|
||||||
|
│ ├── mesh.py # AtomizerMesh
|
||||||
|
│ ├── boundary_conditions.py # AtomizerBCs
|
||||||
|
│ ├── material.py # AtomizerMaterial
|
||||||
|
│ ├── results.py # AtomizerResults
|
||||||
|
│ └── validators.py # Cross-contract sanity checks
|
||||||
|
├── processors/
|
||||||
|
│ ├── base.py # Abstract base classes
|
||||||
|
│ ├── geometry/
|
||||||
|
│ │ ├── build123d_geometry.py
|
||||||
|
│ │ ├── nx_geometry.py
|
||||||
|
│ │ └── step_import.py
|
||||||
|
│ ├── meshing/
|
||||||
|
│ │ ├── gmsh_mesher.py
|
||||||
|
│ │ └── nx_mesher.py
|
||||||
|
│ ├── solvers/
|
||||||
|
│ │ ├── nastran_solver.py
|
||||||
|
│ │ ├── calculix_solver.py
|
||||||
|
│ │ └── openfoam_solver.py # Sprint 4
|
||||||
|
│ ├── converters/
|
||||||
|
│ │ ├── meshio_converter.py
|
||||||
|
│ │ └── pynastran_bridge.py
|
||||||
|
│ └── postprocessing/
|
||||||
|
│ ├── pyvista_post.py
|
||||||
|
│ └── paraview_post.py
|
||||||
|
├── orchestrator/
|
||||||
|
│ ├── pipeline.py # Solver-agnostic run sequencing
|
||||||
|
│ ├── auto_select.py # Toolchain routing logic
|
||||||
|
│ └── coupling.py # Sprint 5: preCICE
|
||||||
|
├── optimization/
|
||||||
|
│ ├── engine.py # Core optimization loop
|
||||||
|
│ ├── optuna_backend.py
|
||||||
|
│ └── pymoo_backend.py # Sprint 6
|
||||||
|
└── mcp_servers/ # Sprint 2-3
|
||||||
|
├── calculix/
|
||||||
|
├── gmsh/
|
||||||
|
├── build123d/
|
||||||
|
└── pynastran/
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 3. Current Environment Assessment
|
||||||
|
|
||||||
|
| Item | Status | Action Required |
|
||||||
|
|------|--------|----------------|
|
||||||
|
| V2 repo (`atomizer/` package) | ❌ Not yet created — still V1 flat layout | Sprint 0: scaffold package structure |
|
||||||
|
| pyNastran | ✅ Installed | None |
|
||||||
|
| CalculiX (ccx) | ❌ Not installed | `apt install calculix-ccx` or Docker |
|
||||||
|
| Gmsh | ❌ Not installed | `pip install gmsh pygmsh` |
|
||||||
|
| Build123d | ❌ Not installed | `pip install build123d` |
|
||||||
|
| meshio | ❌ Not installed | `pip install meshio` |
|
||||||
|
| PyVista | ❌ Not installed | `pip install pyvista` |
|
||||||
|
| ParaView/pvpython | ❌ Not installed | `apt install paraview` |
|
||||||
|
| pymoo | ❌ Not installed | `pip install pymoo` (Sprint 6) |
|
||||||
|
| OpenFOAM | ❌ Not installed | Docker recommended (Sprint 4) |
|
||||||
|
|
||||||
|
**First blocker:** Package installs on T420. Either direct install or Docker-based dev environment.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 4. Sprint Plan
|
||||||
|
|
||||||
|
### Sprint 0: Environment + Scaffold (1–2 days)
|
||||||
|
**Goal:** Working dev environment and V2 package skeleton.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Install core Python packages (gmsh, build123d, meshio, pyvista) | Developer/IT | 🟢 Full | Working imports |
|
||||||
|
| Install CalculiX (`apt install calculix-ccx`) | Developer/IT | 🟢 Full | `ccx` on PATH |
|
||||||
|
| Scaffold `atomizer/` package with `__init__.py` stubs | Developer | 🟢 Full | Package importable |
|
||||||
|
| Create `tests/benchmarks/` with 3 analytical reference cases | Tech Lead | 🟢 Full | JSON expected-value files |
|
||||||
|
|
||||||
|
**Analytical benchmarks (known-answer problems):**
|
||||||
|
1. **Cantilever beam** — tip deflection = PL³/3EI (linear static)
|
||||||
|
2. **Plate with hole** — SCF ≈ 3.0 at hole edge (stress concentration)
|
||||||
|
3. **Simply supported beam** — first natural frequency = (π²/L²)√(EI/ρA) (modal)
|
||||||
|
|
||||||
|
**Antoine gate:** None — this is infrastructure.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Sprint 1: Contracts + Structural Bridge Baseline (1 week)
|
||||||
|
**Goal:** Contract-driven NX/Nastran baseline with format conversion verification.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Implement 5 contract dataclasses | Developer | 🟢 95% | `contracts/*.py` with full type hints |
|
||||||
|
| Implement `validators.py` | Developer | 🟢 95% | Unit-consistent checks, BC physics checks |
|
||||||
|
| Implement `processors/base.py` abstract classes | Tech Lead → Developer | 🟢 95% | `GeometryProcessor`, `MeshProcessor`, `SolverProcessor` ABCs |
|
||||||
|
| Wrap existing NX/Nastran into `nastran_solver.py` | NX Expert → Developer | 🟡 70% | Existing workflow through new interface |
|
||||||
|
| Implement `meshio_converter.py` | Developer | 🟢 95% | BDF ↔ INP ↔ MSH ↔ VTK round-trip |
|
||||||
|
| Implement `pynastran_bridge.py` | Developer | 🟢 95% | BDF read/modify, OP2 parse → AtomizerResults |
|
||||||
|
| Implement `pipeline.py` skeleton | Tech Lead → Developer | 🟢 90% | Sequential pipeline runner |
|
||||||
|
| Unit tests for all contracts + converters | Developer | 🟢 95% | pytest suite passing |
|
||||||
|
|
||||||
|
**Success criterion:** Existing NX/Nastran workflow passes through new architecture with zero regression.
|
||||||
|
|
||||||
|
**Antoine gate:** Provide 3 trusted benchmark studies with known expected outputs for parity check.
|
||||||
|
|
||||||
|
**Risk:** Hidden assumptions in legacy NX/Nastran parsing may break when abstracted.
|
||||||
|
**Mitigation:** Run full diff on old vs new output before declaring parity.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Sprint 2: Open Structural Lane — CalculiX + Gmsh + Build123d (1–2 weeks)
|
||||||
|
**Goal:** Full Linux-headless structural optimization loop with zero NX dependency.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Implement `build123d_geometry.py` | Developer | 🟢 90% | DV dict → Build123d → STEP |
|
||||||
|
| Implement `step_import.py` | Developer | 🟢 95% | STEP → AtomizerGeometry |
|
||||||
|
| Implement `gmsh_mesher.py` | Developer | 🟢 90% | STEP → Gmsh → AtomizerMesh (with quality metrics) |
|
||||||
|
| Implement `calculix_solver.py` | Tech Lead → Developer | 🟡 80% | .inp generation + ccx exec + .frd parsing → AtomizerResults |
|
||||||
|
| Implement `pyvista_post.py` | Developer | 🟢 95% | AtomizerResults → contour plots (PNG/VTK) |
|
||||||
|
| Implement `optuna_backend.py` (adapted) | Optimizer → Developer | 🟢 90% | Contract-aware Optuna loop |
|
||||||
|
| Run 3 analytical benchmarks through full pipeline | Tech Lead | 🟢 90% | Pass/fail report vs known answers |
|
||||||
|
| CalculiX vs Nastran parity comparison | Tech Lead | 🟡 70% | Delta report on shared benchmark |
|
||||||
|
|
||||||
|
**Demo scenario:**
|
||||||
|
```
|
||||||
|
Parametric bracket (thickness, fillet_radius, rib_width)
|
||||||
|
→ Build123d generates STEP
|
||||||
|
→ Gmsh meshes
|
||||||
|
→ CalculiX solves (SOL 101 equivalent)
|
||||||
|
→ PyVista renders stress contour
|
||||||
|
→ Optuna optimizes for min mass @ stress constraint
|
||||||
|
→ Full loop on Linux, no NX
|
||||||
|
```
|
||||||
|
|
||||||
|
**Success criteria:**
|
||||||
|
- [ ] 3 analytical benchmarks pass within 2% of theory
|
||||||
|
- [ ] CalculiX vs Nastran delta < 5% on stress/displacement for shared benchmark
|
||||||
|
- [ ] Full optimization loop completes 50+ trials unattended
|
||||||
|
|
||||||
|
**Antoine gate:**
|
||||||
|
1. Approve CalculiX vs Nastran parity tolerance (proposed: 5% on stress, 3% on displacement)
|
||||||
|
2. Validate one benchmark result manually
|
||||||
|
3. Review Build123d geometry quality for representative model
|
||||||
|
|
||||||
|
**Risks:**
|
||||||
|
- Gmsh mesh quality on sharp fillets → **Mitigation:** define mesh size presets, add Jacobian quality check
|
||||||
|
- CalculiX .frd parsing edge cases → **Mitigation:** test against multiple element types (CQUAD4 equivalent, CHEXA equivalent)
|
||||||
|
- Build123d geometry failures on complex shapes → **Mitigation:** start with simple parametric bracket, escalate complexity gradually
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Sprint 3: MVP Hardening + Client-Grade Post-Processing (1 week)
|
||||||
|
**Goal:** Production-quality outputs from both solver lanes, side-by-side comparison capability.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Implement `paraview_post.py` | Developer | 🟢 90% | Publication-quality figures (headless pvpython) |
|
||||||
|
| Implement `auto_select.py` | Tech Lead → Developer | 🟡 75% | Toolchain routing rules (NX lane vs open lane) |
|
||||||
|
| Implement `spec/validator.py` | Developer | 🟢 95% | AtomizerSpec v3.0 schema validation |
|
||||||
|
| Dual-lane comparison report | Post-Processor → Developer | 🟢 85% | Side-by-side Nastran vs CalculiX with pass/fail |
|
||||||
|
| Regression test suite | Auditor → Developer | 🟢 90% | Automated benchmark + parity checks |
|
||||||
|
| MCP-CalculiX server | MCP Engineer → Developer | 🟡 70% | Tool-call interface for CalculiX |
|
||||||
|
| MCP-Gmsh server | MCP Engineer → Developer | 🟡 70% | Tool-call interface for Gmsh |
|
||||||
|
| Documentation: Integration Guide | Secretary | 🟢 95% | `docs/DEV/INTEGRATION-GUIDE.md` |
|
||||||
|
|
||||||
|
**Success criteria:**
|
||||||
|
- [ ] Dual-lane comparison passes on all 3 benchmarks
|
||||||
|
- [ ] Automated regression suite runs in CI
|
||||||
|
- [ ] MCP servers pass basic smoke tests
|
||||||
|
|
||||||
|
**Antoine gate:**
|
||||||
|
1. Approve report template and required figure list
|
||||||
|
2. Define auto-select routing rules (when NX vs when open-source)
|
||||||
|
3. Sign off MVP as "usable for real studies"
|
||||||
|
|
||||||
|
**🏁 MVP EXIT — after Sprint 3, Atomizer can run full structural optimization on Linux without NX.**
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Sprint 4: CFD Lane — OpenFOAM (1–2 weeks)
|
||||||
|
**Goal:** Automated CFD/thermal screening within the same orchestration framework.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Install OpenFOAM (Docker recommended) | IT | 🟢 Full | Working `simpleFoam` / `buoyantSimpleFoam` |
|
||||||
|
| Implement `openfoam_solver.py` | Tech Lead → Developer | 🟡 65% | Case generation + execution + result parsing |
|
||||||
|
| Extend `gmsh_mesher.py` with CFD presets | Developer | 🟡 75% | Boundary layer meshing, inflation layers |
|
||||||
|
| Extend contracts for CFD quantities | Tech Lead → Developer | 🟡 70% | Pressure, velocity, temperature fields in AtomizerResults |
|
||||||
|
| 2 CFD validation cases | Tech Lead | 🟡 60% | Lid-driven cavity + pipe flow (known analytical/reference) |
|
||||||
|
|
||||||
|
**Demo scenario:**
|
||||||
|
```
|
||||||
|
Electronics enclosure airflow
|
||||||
|
→ STEP → Gmsh CFD mesh → OpenFOAM (buoyantSimpleFoam)
|
||||||
|
→ PyVista thermal map + pressure drop
|
||||||
|
→ Variant ranking by max temperature
|
||||||
|
```
|
||||||
|
|
||||||
|
**Antoine gate:**
|
||||||
|
1. Lock one validated starter case template before generalization
|
||||||
|
2. Define screening-fidelity defaults (mesh size, turbulence model)
|
||||||
|
3. Validate thermal results against engineering judgment
|
||||||
|
|
||||||
|
**Risk:** OpenFOAM setup complexity is high. Dictionary validation is error-prone.
|
||||||
|
**Mitigation:** Start with one locked template, generalize only after it works.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Sprint 5: Coupled Thermo-Structural — preCICE (1–2 weeks)
|
||||||
|
**Goal:** Two-way coupled OpenFOAM ↔ CalculiX simulations.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Install preCICE + adapters | IT | 🟢 Full | preCICE + CalculiX adapter + OpenFOAM adapter |
|
||||||
|
| Implement `coupling.py` | Tech Lead → Developer | 🟡 60% | Coupled orchestration with convergence monitoring |
|
||||||
|
| 1 coupled benchmark | Tech Lead | 🔴 50% | Heated plate with thermal expansion |
|
||||||
|
|
||||||
|
**Antoine gate:** Approve coupling parameters and convergence criteria.
|
||||||
|
|
||||||
|
**Risk:** Coupling divergence, debugging complexity.
|
||||||
|
**Mitigation:** Conservative time-step, explicit convergence checks, one golden benchmark.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Sprint 6: Multi-Objective + MDO — pymoo + OpenMDAO (1–2 weeks)
|
||||||
|
**Goal:** Pareto optimization across multiple objectives and disciplines.
|
||||||
|
|
||||||
|
| Task | Owner | Autonomy | Deliverable |
|
||||||
|
|------|-------|----------|-------------|
|
||||||
|
| Implement `pymoo_backend.py` | Optimizer → Developer | 🟢 85% | NSGA-II/III alongside Optuna |
|
||||||
|
| Pareto front visualization | Post-Processor → Developer | 🟢 90% | Interactive Pareto plots |
|
||||||
|
| OpenMDAO integration (if scope allows) | Tech Lead → Developer | 🟡 60% | MDO wiring for multi-discipline |
|
||||||
|
| 1 multi-objective demo | Optimizer + Tech Lead | 🟡 70% | Mass vs stress vs temperature Pareto |
|
||||||
|
|
||||||
|
**Antoine gate:** Define objective scaling and hard constraints.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 5. Semi-Autonomous Workflow
|
||||||
|
|
||||||
|
```
|
||||||
|
┌─────────────────────────────────────────────────────────┐
|
||||||
|
│ PER-SPRINT LOOP │
|
||||||
|
│ │
|
||||||
|
│ 1. Antoine picks sprint / approves scope [YOU] │
|
||||||
|
│ 2. HQ researches + designs architecture [AUTO] │
|
||||||
|
│ 3. Auditor reviews design for risks [AUTO] │
|
||||||
|
│ 4. Antoine approves architecture (15 min) [YOU] │
|
||||||
|
│ 5. Developer implements + writes tests [AUTO] │
|
||||||
|
│ 6. Auditor reviews code against protocols [AUTO] │
|
||||||
|
│ 7. Antoine validates one benchmark (2-3 hrs) [YOU] │
|
||||||
|
│ 8. Merge → next sprint [AUTO] │
|
||||||
|
│ │
|
||||||
|
│ Your time: ~2-3 hours/sprint │
|
||||||
|
│ HQ time: days of implementation/sprint │
|
||||||
|
└─────────────────────────────────────────────────────────┘
|
||||||
|
```
|
||||||
|
|
||||||
|
**What runs fully autonomously (steps 2-3, 5-6):**
|
||||||
|
- Research tool capabilities, formats, Python bindings
|
||||||
|
- Design processor architecture and contract extensions
|
||||||
|
- Implement Python adapters, parsers, converters
|
||||||
|
- Write and run unit tests against analytical benchmarks
|
||||||
|
- Audit code against Atomizer protocols
|
||||||
|
- Generate regression reports
|
||||||
|
|
||||||
|
**What needs your engineering judgment (steps 1, 4, 7):**
|
||||||
|
- Tool priority sequencing (strategic call)
|
||||||
|
- Architecture approval (15-min review)
|
||||||
|
- Cross-solver parity acceptance (is 5% delta OK?)
|
||||||
|
- Benchmark validation (does this match physics?)
|
||||||
|
- Geometry quality assessment (does Build123d output look right?)
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 6. Quality Gates (Auditor-Defined)
|
||||||
|
|
||||||
|
### Per-Processor Gate
|
||||||
|
- [ ] Processor implements abstract base class correctly
|
||||||
|
- [ ] Round-trip test: contract → native format → solve → parse → contract
|
||||||
|
- [ ] At least 1 analytical benchmark passes within tolerance
|
||||||
|
- [ ] Unit test coverage ≥ 80% for parser logic
|
||||||
|
- [ ] Error handling for: missing files, solver crash, malformed output
|
||||||
|
- [ ] Documentation: input/output formats, known limitations
|
||||||
|
|
||||||
|
### Per-Sprint Gate
|
||||||
|
- [ ] All processor gates pass
|
||||||
|
- [ ] Integration test: full pipeline from AtomizerSpec → results
|
||||||
|
- [ ] Regression: no existing tests broken
|
||||||
|
- [ ] Parity check (if applicable): new solver vs reference solver
|
||||||
|
- [ ] Tech Lead sign-off on physics validity
|
||||||
|
- [ ] Auditor sign-off on code quality + protocol compliance
|
||||||
|
|
||||||
|
### MVP Gate (Sprint 3 Exit)
|
||||||
|
- [ ] 3 analytical benchmarks pass (cantilever, plate-hole, modal)
|
||||||
|
- [ ] CalculiX vs Nastran parity < 5% stress, < 3% displacement
|
||||||
|
- [ ] 50-trial optimization completes unattended
|
||||||
|
- [ ] Dual-lane comparison report generates automatically
|
||||||
|
- [ ] Antoine validates one real-world study through the new pipeline
|
||||||
|
- [ ] All regression tests pass in CI
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 7. Risk Register
|
||||||
|
|
||||||
|
| # | Risk | Impact | Likelihood | Mitigation | Owner |
|
||||||
|
|---|------|--------|------------|------------|-------|
|
||||||
|
| R1 | CalculiX vs Nastran parity exceeds tolerance | High | Medium | Start with simple geometries, document element type mapping, investigate mesh sensitivity | Tech Lead |
|
||||||
|
| R2 | Gmsh mesh quality on complex geometry | Medium | Medium | Define quality thresholds, add Jacobian/aspect-ratio checks, fallback presets | Tech Lead |
|
||||||
|
| R3 | Build123d limitations on complex parametric models | Medium | Low | Start simple, escalate complexity, keep NX lane as fallback | Developer |
|
||||||
|
| R4 | Contract design locks in wrong abstractions | High | Low | Freeze contracts only after Sprint 1 validation, allow minor evolution in Sprint 2 | Tech Lead + Auditor |
|
||||||
|
| R5 | Package dependency conflicts on T420 | Low | Medium | Use venv or Docker dev environment | IT |
|
||||||
|
| R6 | OpenFOAM setup complexity delays Sprint 4 | Medium | High | Docker-first approach, one locked template | IT + Tech Lead |
|
||||||
|
| R7 | Scope creep into expansion tools before MVP stable | High | Medium | Hard gate: no Sprint 4+ work until Sprint 3 exit criteria met | Manager + Auditor |
|
||||||
|
| R8 | MCP server maintenance burden | Low | Medium | MVP cap at 4 MCP servers, thin wrappers only | MCP Engineer |
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 8. Tool Installation Reference
|
||||||
|
|
||||||
|
### Sprint 0-2 (Core)
|
||||||
|
```bash
|
||||||
|
# Python packages
|
||||||
|
pip install gmsh pygmsh build123d meshio pyvista
|
||||||
|
|
||||||
|
# CalculiX solver
|
||||||
|
sudo apt install calculix-ccx
|
||||||
|
|
||||||
|
# ParaView (Sprint 3)
|
||||||
|
sudo apt install paraview
|
||||||
|
```
|
||||||
|
|
||||||
|
### Sprint 4+ (Expansion)
|
||||||
|
```bash
|
||||||
|
# OpenFOAM via Docker
|
||||||
|
docker pull openfoam/openfoam-dev
|
||||||
|
|
||||||
|
# preCICE
|
||||||
|
sudo apt install libprecice-dev python3-precice
|
||||||
|
|
||||||
|
# pymoo
|
||||||
|
pip install pymoo
|
||||||
|
|
||||||
|
# OpenMDAO
|
||||||
|
pip install openmdao
|
||||||
|
```
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 9. Success Metrics
|
||||||
|
|
||||||
|
| Metric | Sprint 3 Target | Sprint 6 Target |
|
||||||
|
|--------|----------------|----------------|
|
||||||
|
| Solver lanes operational | 2 (Nastran + CalculiX) | 4 (+OpenFOAM + coupled) |
|
||||||
|
| Optimization trials/hr (bracket-class) | 50+ | 100+ |
|
||||||
|
| Analytical benchmarks passing | 3 | 8+ |
|
||||||
|
| Cross-solver parity verified | Nastran ↔ CalculiX | + OpenFOAM thermal |
|
||||||
|
| Automation level (no human in loop) | 70% | 85% |
|
||||||
|
| MCP servers | 2 (CalculiX, Gmsh) | 4 |
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 10. Immediate Next Steps
|
||||||
|
|
||||||
|
1. **Antoine:** Approve this plan and Sprint 0-1 scope
|
||||||
|
2. **IT/Developer:** Run Sprint 0 package installs (est. 1-2 hours)
|
||||||
|
3. **Tech Lead:** Finalize contract dataclass specs with field-level detail
|
||||||
|
4. **Developer:** Scaffold `atomizer/` package structure
|
||||||
|
5. **Auditor:** Prepare benchmark expected-value files for 3 analytical cases
|
||||||
|
6. **Manager:** Create Mission Dashboard tasks for Sprint 0 + Sprint 1
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
*This plan is a living document. Update after each sprint retrospective.*
|
||||||
50
hq/.gitignore
vendored
50
hq/.gitignore
vendored
@@ -1,6 +1,54 @@
|
|||||||
|
# Secrets
|
||||||
.env
|
.env
|
||||||
*.log
|
.env.*
|
||||||
|
config/*.env
|
||||||
|
config/.discord-tokens.env
|
||||||
|
config/shared-credentials.json
|
||||||
|
|
||||||
|
# Python
|
||||||
|
__pycache__/
|
||||||
|
*.py[cod]
|
||||||
|
*.so
|
||||||
|
.venv/
|
||||||
|
venv/
|
||||||
|
|
||||||
|
# Node
|
||||||
|
node_modules/
|
||||||
|
package-lock.json
|
||||||
|
|
||||||
|
# Job queue data (ephemeral)
|
||||||
job-queue/inbox/*
|
job-queue/inbox/*
|
||||||
job-queue/outbox/*
|
job-queue/outbox/*
|
||||||
job-queue/archive/*
|
job-queue/archive/*
|
||||||
!job-queue/*/.gitkeep
|
!job-queue/*/.gitkeep
|
||||||
|
|
||||||
|
# Tool venvs
|
||||||
|
tools/nxopen-mcp/.venv/
|
||||||
|
|
||||||
|
# Dashboard deps + build
|
||||||
|
dashboard/frontend/node_modules/
|
||||||
|
dashboard/frontend/dist/
|
||||||
|
dashboard/venv/
|
||||||
|
|
||||||
|
# Bridge deps
|
||||||
|
bridge/node_modules/
|
||||||
|
discord-bridge/node_modules/
|
||||||
|
|
||||||
|
# Instances
|
||||||
|
instances/*/browser/
|
||||||
|
|
||||||
|
# Logs (ephemeral)
|
||||||
|
logs/
|
||||||
|
*.log
|
||||||
|
|
||||||
|
# Handoffs (ephemeral orchestration data)
|
||||||
|
handoffs/
|
||||||
|
|
||||||
|
# OS
|
||||||
|
.DS_Store
|
||||||
|
Thumbs.db
|
||||||
|
|
||||||
|
# Legacy deliverables
|
||||||
|
deliverables/
|
||||||
|
tools/nxopen-mcp/
|
||||||
|
dashboard/
|
||||||
|
|||||||
86
hq/README.md
86
hq/README.md
@@ -1,45 +1,63 @@
|
|||||||
# Atomizer Engineering Co.
|
# Atomizer-HQ 🎯
|
||||||
|
|
||||||
AI-powered FEA optimization company running on Clawdbot multi-agent.
|
> The AI operations team that builds, tests, improves, and operates [Atomizer](http://192.168.86.50:3000/Antoine/Atomizer-V2).
|
||||||
|
|
||||||
## Quick Start
|
## What is HQ?
|
||||||
|
|
||||||
1. Install Docker: `sudo apt install docker.io docker-compose-v2 -y`
|
**Atomizer** = the product (optimization framework, code, AOM docs)
|
||||||
2. Copy `.env.template` → `.env` and fill in tokens
|
**Atomizer-HQ** = the AI team that operates it (agent workspaces, memory, skills, orchestration)
|
||||||
3. Build image: `docker build -t clawdbot:local .` (from Clawdbot repo)
|
|
||||||
4. Start: `docker compose up -d`
|
Think of it as: Atomizer is the race car, HQ is the pit crew.
|
||||||
5. Check logs: `docker compose logs -f atomizer-gateway`
|
|
||||||
|
|
||||||
## Structure
|
## Structure
|
||||||
|
|
||||||
```
|
```
|
||||||
atomizer/
|
atomizer-hq/
|
||||||
├── docker-compose.yml # Docker Compose config
|
├── workspaces/ # Agent workspaces (SOUL.md, IDENTITY.md, MEMORY.md, etc.)
|
||||||
├── .env.template # Environment template (copy to .env)
|
│ ├── manager/ # 🎯 Engineering Manager / Orchestrator
|
||||||
├── config/
|
│ ├── secretary/ # 📋 CEO Interface, Admin
|
||||||
│ └── clawdbot.json # Gateway config (multi-agent)
|
│ ├── technical-lead/ # 🔧 FEA Expert, R&D Lead
|
||||||
├── workspaces/
|
│ ├── optimizer/ # ⚡ Algorithm Specialist
|
||||||
│ ├── manager/ # 🎯 Manager agent workspace
|
│ ├── study-builder/ # 🏗️ Study Code Engineer
|
||||||
│ ├── secretary/ # 📋 Secretary agent workspace
|
│ ├── auditor/ # 🔍 Quality Gatekeeper
|
||||||
│ └── technical-lead/ # 🔧 Technical Lead agent workspace
|
│ ├── webster/ # 🌐 Web Research
|
||||||
├── skills/
|
│ └── nx-expert/ # 🖥️ NX/Simcenter Specialist
|
||||||
│ ├── atomizer-company/ # Company identity skill
|
├── skills/ # HQ-specific agent skills
|
||||||
│ └── atomizer-protocols/ # Engineering protocols skill
|
│ ├── atomizer-company/ # Company identity
|
||||||
├── job-queue/
|
│ └── atomizer-protocols/ # Engineering protocols
|
||||||
│ ├── inbox/ # Results from Windows → agents
|
├── shared/ # Shared resources (tools, skills, windows helpers)
|
||||||
│ ├── outbox/ # Job files from agents → Windows
|
├── hq/ # HQ operational data (taskboard, condensations)
|
||||||
│ └── archive/ # Processed jobs
|
├── mission-control/ # Mission dashboard (web UI)
|
||||||
└── shared/ # Shared resources (read-only)
|
├── scripts/ # Automation scripts
|
||||||
|
├── tools/ # MCP servers, utilities
|
||||||
|
├── config/ # Gateway config (secrets excluded)
|
||||||
|
├── CHANNELS.md # Slack channel mapping
|
||||||
|
└── docker-compose.yml # Legacy Docker config
|
||||||
```
|
```
|
||||||
|
|
||||||
## Agents (Phase 0)
|
## Agents
|
||||||
|
|
||||||
| Agent | Emoji | Channel | Model |
|
| Agent | Emoji | Model | Status |
|
||||||
|-------|-------|---------|-------|
|
|-------|-------|-------|--------|
|
||||||
| Manager | 🎯 | #hq | Opus 4.6 |
|
| Manager | 🎯 | Opus 4.6 | Active |
|
||||||
| Secretary | 📋 | #secretary | Opus 4.6 |
|
| Secretary | 📋 | Opus 4.6 | Active |
|
||||||
| Technical Lead | 🔧 | (delegated) | Opus 4.6 |
|
| Technical Lead | 🔧 | Opus 4.6 | Active |
|
||||||
|
| Optimizer | ⚡ | Opus 4.6 | Active |
|
||||||
|
| Study Builder | 🏗️ | Opus 4.6 | Active |
|
||||||
|
| Auditor | 🔍 | Opus 4.6 | Active |
|
||||||
|
| Webster | 🌐 | Opus 4.6 | Active |
|
||||||
|
| NX Expert | 🖥️ | Opus 4.6 | Phase 2 |
|
||||||
|
|
||||||
## Ports
|
## Key Decisions
|
||||||
- Mario (existing): 18789 (systemd)
|
|
||||||
- Atomizer (new): 18790 → 18789 (Docker)
|
- **DEC-037**: Atomizer and HQ are separate entities (2026-02-23)
|
||||||
|
- HQ repo: `192.168.86.50:3000/Antoine/Atomizer-HQ`
|
||||||
|
- Atomizer V2 repo: `192.168.86.50:3000/Antoine/Atomizer-V2`
|
||||||
|
- HQ follows AOM as its operating manual, but HQ configs live here
|
||||||
|
|
||||||
|
## Infrastructure
|
||||||
|
|
||||||
|
- **Host:** T420 (clawdbot)
|
||||||
|
- **Platform:** OpenClaw multi-agent gateway
|
||||||
|
- **Channels:** Dedicated Slack workspace
|
||||||
|
- **CEO:** Antoine Letarte
|
||||||
|
|||||||
@@ -1,44 +0,0 @@
|
|||||||
#!/usr/bin/env bash
|
|
||||||
# Atomizer Cluster Management Script
|
|
||||||
set -euo pipefail
|
|
||||||
|
|
||||||
AGENTS=(manager tech-lead secretary auditor optimizer study-builder nx-expert webster)
|
|
||||||
SERVICE_PREFIX="openclaw-atomizer@"
|
|
||||||
|
|
||||||
case "${1:-help}" in
|
|
||||||
start)
|
|
||||||
for a in "${AGENTS[@]}"; do
|
|
||||||
echo "Starting ${a}..."
|
|
||||||
systemctl --user enable --now "${SERVICE_PREFIX}${a}.service"
|
|
||||||
done
|
|
||||||
echo "All agents started."
|
|
||||||
;;
|
|
||||||
stop)
|
|
||||||
for a in "${AGENTS[@]}"; do
|
|
||||||
echo "Stopping ${a}..."
|
|
||||||
systemctl --user stop "${SERVICE_PREFIX}${a}.service" || true
|
|
||||||
done
|
|
||||||
echo "All agents stopped."
|
|
||||||
;;
|
|
||||||
restart)
|
|
||||||
for a in "${AGENTS[@]}"; do
|
|
||||||
echo "Restarting ${a}..."
|
|
||||||
systemctl --user restart "${SERVICE_PREFIX}${a}.service"
|
|
||||||
done
|
|
||||||
echo "All agents restarted."
|
|
||||||
;;
|
|
||||||
status)
|
|
||||||
for a in "${AGENTS[@]}"; do
|
|
||||||
systemctl --user status "${SERVICE_PREFIX}${a}.service" --no-pager -l 2>/dev/null | head -3
|
|
||||||
echo "---"
|
|
||||||
done
|
|
||||||
;;
|
|
||||||
logs)
|
|
||||||
agent="${2:-manager}"
|
|
||||||
journalctl --user -u "${SERVICE_PREFIX}${agent}.service" -f --no-pager
|
|
||||||
;;
|
|
||||||
*)
|
|
||||||
echo "Usage: $0 {start|stop|restart|status|logs [agent]}"
|
|
||||||
exit 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
@@ -21,7 +21,7 @@
|
|||||||
name: "Manager",
|
name: "Manager",
|
||||||
workspace: "/home/papa/atomizer/workspaces/manager",
|
workspace: "/home/papa/atomizer/workspaces/manager",
|
||||||
identity: { name: "Atomizer Manager", emoji: "🎯" },
|
identity: { name: "Atomizer Manager", emoji: "🎯" },
|
||||||
model: "anthropic/claude-opus-4-6",
|
model: "openai-codex/gpt-5.4",
|
||||||
groupChat: { mentionPatterns: ["@manager", "@Manager", "🎯"] },
|
groupChat: { mentionPatterns: ["@manager", "@Manager", "🎯"] },
|
||||||
subagents: { allowAgents: ["*"] }
|
subagents: { allowAgents: ["*"] }
|
||||||
},
|
},
|
||||||
|
|||||||
@@ -1,11 +0,0 @@
|
|||||||
{
|
|
||||||
"schemaVersion": "1.0",
|
|
||||||
"runId": "orch-1771176737-8c14d6cf",
|
|
||||||
"agent": "webster",
|
|
||||||
"status": "failed",
|
|
||||||
"result": null,
|
|
||||||
"artifacts": [],
|
|
||||||
"confidence": "low",
|
|
||||||
"notes": "web_search tool failed due to a missing Brave API key. I am unable to access the internet to find the density of Zerodur.",
|
|
||||||
"timestamp": "2026-02-15T12:32:00-05:00"
|
|
||||||
}
|
|
||||||
@@ -1,11 +0,0 @@
|
|||||||
{
|
|
||||||
"schemaVersion": "1.0",
|
|
||||||
"runId": "orch-1771176838-52dc0c1b",
|
|
||||||
"agent": "webster",
|
|
||||||
"status": "blocked",
|
|
||||||
"result": "Could not retrieve CTE and density for Clearceram-Z HS.",
|
|
||||||
"artifacts": [],
|
|
||||||
"confidence": "low",
|
|
||||||
"notes": "The primary data source appears to be a PDF file (https://oharacorp.com/wp-content/uploads/2022/11/clearerem.pdf). My current tools are unable to parse PDF files to extract the required data. I was also unable to find the data in a standard HTML or text format.",
|
|
||||||
"timestamp": "2026-02-15T12:35:45-05:00"
|
|
||||||
}
|
|
||||||
17
hq/hq/MODEL-CHANGES-NEEDED.md
Normal file
17
hq/hq/MODEL-CHANGES-NEEDED.md
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
# MODEL-CHANGES-NEEDED
|
||||||
|
|
||||||
|
Do **not** apply automatically. These are required edits for gateway `config.patch`.
|
||||||
|
|
||||||
|
## Required model assignment changes
|
||||||
|
|
||||||
|
1. **optimizer**
|
||||||
|
- Current: `anthropic/claude-opus-4-6`
|
||||||
|
- Change to: `anthropic/claude-sonnet-4-5`
|
||||||
|
|
||||||
|
2. **secretary**
|
||||||
|
- Current: `anthropic/claude-sonnet-4-5`
|
||||||
|
- Change to: `google/gemini-2.5-flash`
|
||||||
|
|
||||||
|
## Rationale
|
||||||
|
- Optimizer workload is mostly structured optimization planning/execution, better cost-efficiency on Sonnet 4.5.
|
||||||
|
- Secretary workload is summarization/admin condensation, best fit and lowest cost on Flash.
|
||||||
46
hq/hq/taskboard.json
Normal file
46
hq/hq/taskboard.json
Normal file
@@ -0,0 +1,46 @@
|
|||||||
|
{
|
||||||
|
"board": "atomizer-hq",
|
||||||
|
"version": "1.0",
|
||||||
|
"tasks": [
|
||||||
|
{
|
||||||
|
"id": "ATZ-001",
|
||||||
|
"title": "Example: Material Trade Study for M2",
|
||||||
|
"description": "Compare Zerodur Class 0 vs CCZ HS for M2/M3 mirrors",
|
||||||
|
"status": "backlog",
|
||||||
|
"priority": "high",
|
||||||
|
"assignee": null,
|
||||||
|
"project": "gigabit-m1",
|
||||||
|
"created": "2026-02-18T20:00:00Z",
|
||||||
|
"updated": "2026-02-18T20:00:00Z",
|
||||||
|
"context": "M2/M3 mirrors need CTE < 0.01 ppm/K at operating temp. Budget constraint.",
|
||||||
|
"subtasks": [
|
||||||
|
{
|
||||||
|
"id": "s1",
|
||||||
|
"title": "Research material properties",
|
||||||
|
"assignee": "webster",
|
||||||
|
"done": false
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"id": "s2",
|
||||||
|
"title": "Technical evaluation",
|
||||||
|
"assignee": "tech-lead",
|
||||||
|
"done": false
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"id": "s3",
|
||||||
|
"title": "Quality review",
|
||||||
|
"assignee": "auditor",
|
||||||
|
"done": false
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"id": "s4",
|
||||||
|
"title": "Summary report",
|
||||||
|
"assignee": "secretary",
|
||||||
|
"done": false
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"deliverables": [],
|
||||||
|
"comments": []
|
||||||
|
}
|
||||||
|
]
|
||||||
|
}
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,34 +0,0 @@
|
|||||||
{
|
|
||||||
"8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0": {
|
|
||||||
"deviceId": "8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0",
|
|
||||||
"publicKey": "fejk4Um31-XMqj58QkHSPd4DepfwG1RfvAgc0pcioe8",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "gateway-client",
|
|
||||||
"clientMode": "backend",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "266c2f244dc4453cb621f7fe9b04c82b",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771083769964,
|
|
||||||
"lastUsedAtMs": 1771252499109
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771083769964,
|
|
||||||
"approvedAtMs": 1771083769964,
|
|
||||||
"displayName": "agent"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18812
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "266c2f244dc4453cb621f7fe9b04c82b",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771252499124
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "8c1e44393c844822a8a5129b69e12c9ebdd8bf93a51eebbfa0c5405c673130d0",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAfejk4Um31+XMqj58QkHSPd4DepfwG1RfvAgc0pcioe8=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIP4KzGQVG2NLIN0Sn8qdfpJUP/+z11Su0LNLvqcucqdc\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771083769933
|
|
||||||
}
|
|
||||||
Binary file not shown.
@@ -1,196 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-auditor.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "google/gemini-2.5-pro"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
\"contextPruning\": {\n \"mode\": \"cache-ttl\",\n \"ttl\": \"15m\",\n \"keepLastAssistants\": 3,\n \"softTrimRatio\": 0.6,\n \"hardClearRatio\": 0.8,\n \"minPrunableToolChars\": 2000\n },\n \"heartbeat\": {\n \"every\": \"30m\",\n \"target\": \"discord\"\n }\n },\n \"list\": [\n {\n \"id\": \"main\",\n \"default\": true,\n \"name\": \"Atomizer Auditor\",\n \"workspace\": \"/home/papa/atomizer/workspaces/auditor\",\n \"model\": \"google/gemini-2.5-pro\",\n \"identity\": {\n \"name\": \"Atomizer Auditor\",\n \"theme\": \"Quality gatekeeper. Skeptical, thorough, direct. Reviews every deliverable. Has veto power.\",\n \"emoji\": \"\\ud83d\\udd0d\"\n },\n \"groupChat\": {\n \"mentionPatterns\": [\n \"@auditor\",\n \"@Auditor\",\n \"\\ud83d\\udd0d\"\n ]\n },\n \"subagents\": {\n \"allowAgents\": [\n \"*\"\n ]\n }\n }\n ]\n },\n \"messages\": {\n \"responsePrefix\": \"[{identity.name}] \",\n \"queue\": {\n \"mode\": \"collect\",\n \"debounceMs\": 2000,\n \"cap\": 20\n },\n \"inbound\": {\n \"debounceMs\": 3000\n },\n \"ackReaction\": \"\",\n \"ackReactionScope\": \"group-mentions\"\n },\n \"commands\": {\n \"native\": \"auto\",\n \"nativeSkills\": \"auto\"\n },\n \"hooks\": {\n \"enabled\": true,\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\",\n \"allowRequestSessionKey\": true,\n \"allowedSessionKeyPrefixes\": [\n \"agent:\",\n \"hook:\"\n ],\n \"allowedAgentIds\": [\n \"*\"\n ]\n },\n \"channels\": {\n \"discord\": {\n \"enabled\": true,\n \"commands\": {\n \"native\": false\n },\n \"groupPolicy\": \"allowlist\",\n \"dm\": {\n \"enabled\": true,\n \"policy\": \"allowlist\",\n \"allowFrom\": [\n \"user:719982779793932419\"\n ]\n },\n \"guilds\": {\n \"1471858733452890132\": {\n \"requireMention\": true,\n \"users\": [\n \"user:719982779793932419\"\n ],\n \"channels\": {\n \"feed\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"technical\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"rnd\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"lessons-learned\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"knowledge-base\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"it\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"proj-hydrotech-beam\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"dm-auditor\": {\n \"allow\": true,\n \"requireMention\": false\n },\n \"hq\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"reports\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"announcements\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"agent-logs\": {\n \"allow\": true,\n \"requireMention\": true\n }\n }\n }\n },\n \"token\": \"${DISCORD_TOKEN_AUDITOR}\",\n \"allowBots\": true\n }\n },\n \"gateway\": {\n \"port\": 18812,\n \"mode\": \"local\",\n \"bind\": \"loopback\",\n \"auth\": {\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n },\n \"remote\": {\n \"url\": \"ws://127.0.0.1:18812\",\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n }\n },\n \"skills\": {\n \"load\": {\n \"extraDirs\": [\n \"/home/papa/atomizer/skills\"\n ]\n }\n },\n \"plugins\": {\n \"entries\": {\n \"discord\": {\n \"enabled\": true\n }\n }\n },\n \"talk\": {\n \"apiKey\": \"sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398\"\n }\n}
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Auditor",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/auditor",
|
|
||||||
"model": "google/gemini-2.5-pro",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Auditor",
|
|
||||||
"theme": "Quality gatekeeper. Skeptical, thorough, direct. Reviews every deliverable. Has veto power.",
|
|
||||||
"emoji": "\ud83d\udd0d"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@auditor",
|
|
||||||
"@Auditor",
|
|
||||||
"\ud83d\udd0d"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-auditor": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_AUDITOR}"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18812,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18812",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T23:34:56.209Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "19df1a6af503f7540765d5640ca6f0c85cf7fdb32ec33ef029878f1f05e37827",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "4b9eec2c8b7d4bf880a482951f5791b7",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771115284656
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "19df1a6af503f7540765d5640ca6f0c85cf7fdb32ec33ef029878f1f05e37827",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAKs86bSka8YGeyRrzn1l/geS+LJTjgMzEPgNJLVilweM=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIKYgmW/aukhjZiBUmuV1gjFr7X4ccTW3eaEWPxgo02+1\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771115284433
|
|
||||||
}
|
|
||||||
@@ -1,29 +0,0 @@
|
|||||||
{
|
|
||||||
"messages": {
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 8
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
},
|
|
||||||
"wizard": {
|
|
||||||
"lastRunAt": "2026-02-15T00:28:05.182Z",
|
|
||||||
"lastRunVersion": "2026.2.12",
|
|
||||||
"lastRunCommand": "doctor",
|
|
||||||
"lastRunMode": "local"
|
|
||||||
},
|
|
||||||
"meta": {
|
|
||||||
"lastTouchedVersion": "2026.2.12",
|
|
||||||
"lastTouchedAt": "2026-02-15T00:28:05.243Z"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,65 +0,0 @@
|
|||||||
{
|
|
||||||
"84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33": {
|
|
||||||
"deviceId": "84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33",
|
|
||||||
"publicKey": "R9ckbOaTvIzdV4-JGOQjCFGdOh_cOJD1CD9jp0p7X7k",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "cli",
|
|
||||||
"clientMode": "cli",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "97dc1fe3641742f5923fe7c5ede21751",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771083738383,
|
|
||||||
"lastUsedAtMs": 1771297525391
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771083738383,
|
|
||||||
"approvedAtMs": 1771083738383
|
|
||||||
},
|
|
||||||
"c92ab2fbfb8dc99f25f79b9761cad67f3f73093a808392af6086a29ca10846a5": {
|
|
||||||
"deviceId": "c92ab2fbfb8dc99f25f79b9761cad67f3f73093a808392af6086a29ca10846a5",
|
|
||||||
"publicKey": "kkyMHTz_r-oIa5saYKBtAyqSm1oLibWtUnNh-klnhdo",
|
|
||||||
"displayName": "agent",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "gateway-client",
|
|
||||||
"clientMode": "backend",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "df722d72f1484b09810717ca02fc975a",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771259015947,
|
|
||||||
"lastUsedAtMs": 1771260174890
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771259015946,
|
|
||||||
"approvedAtMs": 1771259015946
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18800
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "97dc1fe3641742f5923fe7c5ede21751",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771297525408
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "84c346672e1521e33c9ef72cda3d141689ec443008da786b7cb5910053640c33",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAR9ckbOaTvIzdV4+JGOQjCFGdOh/cOJD1CD9jp0p7X7k=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIHAPhhhmTzddtgLJyJtUn82Bxp9ZuELCR73f0DNmgBIf\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771083738340
|
|
||||||
}
|
|
||||||
Binary file not shown.
@@ -1,293 +0,0 @@
|
|||||||
{
|
|
||||||
"meta": {
|
|
||||||
"lastTouchedVersion": "2026.2.12",
|
|
||||||
"lastTouchedAt": "2026-02-15T02:04:34.030Z"
|
|
||||||
},
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "google/gemini-2.5-pro"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"contextPruning": {
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"heartbeat": {
|
|
||||||
"every": "30m",
|
|
||||||
"target": "discord"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
|
||||||
"model": "google/gemini-2.5-pro",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
|
||||||
"emoji": "\ud83c\udfaf"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@manager",
|
|
||||||
"@Manager",
|
|
||||||
"\ud83c\udfaf"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"token": "MTQ3MTg2NTQ3OTA1MTM0NjAwMw.GfLrsO.Ksikd8xoXQjtO7XcBCKRSA7wnaDzDdSPsfv6SY",
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-manager": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"mode": "socket",
|
|
||||||
"webhookPath": "/slack/events",
|
|
||||||
"enabled": false,
|
|
||||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
|
||||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
|
||||||
"userTokenReadOnly": true,
|
|
||||||
"allowBots": false,
|
|
||||||
"requireMention": false,
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"historyLimit": 50,
|
|
||||||
"reactionNotifications": "all",
|
|
||||||
"thread": {
|
|
||||||
"historyScope": "thread",
|
|
||||||
"inheritParent": true
|
|
||||||
},
|
|
||||||
"actions": {
|
|
||||||
"reactions": true,
|
|
||||||
"messages": true,
|
|
||||||
"pins": true,
|
|
||||||
"memberInfo": true,
|
|
||||||
"emojiList": true
|
|
||||||
},
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"U0AE3J9MDND"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"C0AEJV13TEU": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0ADJALL61Z": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AD9F7LYNB": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AE4CESCC9": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AEB39CE5U": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18800,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18800",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"enabled": false
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"models": {
|
|
||||||
"providers": {
|
|
||||||
"google": {
|
|
||||||
"baseUrl": "https://generativelanguage.googleapis.com/v1beta",
|
|
||||||
"apiKey": "AIzaSyBtzXpScWuTYWxkuFJNiAToRFH_L0r__Bg",
|
|
||||||
"api": "google-generative-ai",
|
|
||||||
"models": [
|
|
||||||
{
|
|
||||||
"id": "gemini-2.5-pro",
|
|
||||||
"name": "Gemini 2.5 Pro",
|
|
||||||
"reasoning": true,
|
|
||||||
"input": [
|
|
||||||
"text",
|
|
||||||
"image"
|
|
||||||
],
|
|
||||||
"contextWindow": 1048576,
|
|
||||||
"maxTokens": 65536
|
|
||||||
},
|
|
||||||
{
|
|
||||||
"id": "gemini-2.5-flash",
|
|
||||||
"name": "Gemini 2.5 Flash",
|
|
||||||
"reasoning": true,
|
|
||||||
"input": [
|
|
||||||
"text",
|
|
||||||
"image"
|
|
||||||
],
|
|
||||||
"contextWindow": 1048576,
|
|
||||||
"maxTokens": 65536
|
|
||||||
}
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,304 +0,0 @@
|
|||||||
{
|
|
||||||
"meta": {
|
|
||||||
"lastTouchedVersion": "2026.2.12",
|
|
||||||
"lastTouchedAt": "2026-02-15T01:07:40.257Z"
|
|
||||||
},
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "anthropic/claude-opus-4-6"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"contextPruning": {
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
|
||||||
"model": "anthropic/claude-opus-4-6",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
|
||||||
"emoji": "\ud83c\udfaf"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@manager",
|
|
||||||
"@Manager",
|
|
||||||
"\ud83c\udfaf"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"token": "MTQ3MTg2NTQ3OTA1MTM0NjAwMw.GfLrsO.Ksikd8xoXQjtO7XcBCKRSA7wnaDzDdSPsfv6SY",
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"general": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"ceo-office": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"daily-standup": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"code-review": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"fea-analysis": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"nx-cad": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"task-board": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"meeting-notes": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"research": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"science": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"active-projects": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"inter-agent": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it-ops": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lab": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"configuration-management": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dl-manager": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"project-dashboard": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"mode": "socket",
|
|
||||||
"webhookPath": "/slack/events",
|
|
||||||
"enabled": true,
|
|
||||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
|
||||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
|
||||||
"userTokenReadOnly": true,
|
|
||||||
"allowBots": false,
|
|
||||||
"requireMention": false,
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"historyLimit": 50,
|
|
||||||
"reactionNotifications": "all",
|
|
||||||
"thread": {
|
|
||||||
"historyScope": "thread",
|
|
||||||
"inheritParent": true
|
|
||||||
},
|
|
||||||
"actions": {
|
|
||||||
"reactions": true,
|
|
||||||
"messages": true,
|
|
||||||
"pins": true,
|
|
||||||
"memberInfo": true,
|
|
||||||
"emojiList": true
|
|
||||||
},
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"U0AE3J9MDND"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"C0AEJV13TEU": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0ADJALL61Z": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AD9F7LYNB": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AE4CESCC9": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AEB39CE5U": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18800,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18800",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,282 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "openai-codex/gpt-5.3-codex"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
|
||||||
"model": "openai-codex/gpt-5.3-codex",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
|
||||||
"emoji": "\ud83c\udfaf"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@manager",
|
|
||||||
"@Manager",
|
|
||||||
"\ud83c\udfaf"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"token": "${DISCORD_TOKEN_MANAGER}",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"general": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"ceo-office": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"daily-standup": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"code-review": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"fea-analysis": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"nx-cad": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"task-board": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"meeting-notes": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"research": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"science": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"active-projects": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"inter-agent": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it-ops": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lab": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"configuration-management": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"mode": "socket",
|
|
||||||
"webhookPath": "/slack/events",
|
|
||||||
"enabled": true,
|
|
||||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
|
||||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
|
||||||
"userTokenReadOnly": true,
|
|
||||||
"allowBots": false,
|
|
||||||
"requireMention": false,
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"historyLimit": 50,
|
|
||||||
"reactionNotifications": "all",
|
|
||||||
"thread": {
|
|
||||||
"historyScope": "thread",
|
|
||||||
"inheritParent": true
|
|
||||||
},
|
|
||||||
"actions": {
|
|
||||||
"reactions": true,
|
|
||||||
"messages": true,
|
|
||||||
"pins": true,
|
|
||||||
"memberInfo": true,
|
|
||||||
"emojiList": true
|
|
||||||
},
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"U0AE3J9MDND"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"C0AEJV13TEU": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0ADJALL61Z": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AD9F7LYNB": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AE4CESCC9": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AEB39CE5U": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18800,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18800",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"meta": {
|
|
||||||
"lastTouchedVersion": "2026.2.12",
|
|
||||||
"lastTouchedAt": "2026-02-14T16:38:57.436Z"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,222 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-manager.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "anthropic/claude-opus-4-6"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/manager",
|
|
||||||
"model": "anthropic/claude-opus-4-6",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Manager",
|
|
||||||
"theme": "Senior engineering manager. Orchestrates, delegates, enforces protocols. Decisive and strategic.",
|
|
||||||
"emoji": "\ud83c\udfaf"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@manager",
|
|
||||||
"@Manager",
|
|
||||||
"\ud83c\udfaf"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"token": "${DISCORD_TOKEN_MANAGER}",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": false,
|
|
||||||
"users": [
|
|
||||||
"719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"ceo-office": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"daily-standup": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"active-projects": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"inter-agent": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"general": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"mode": "socket",
|
|
||||||
"webhookPath": "/slack/events",
|
|
||||||
"enabled": true,
|
|
||||||
"botToken": "xoxb-10470305040052-10460352291747-t1rf0tPohZyniT7LGlfkHcTc",
|
|
||||||
"appToken": "xapp-1-A0ADM99RSLV-10460354049203-72848191ab9a849e61e1bf8c15d4240d4cf2fd1d8f6dd45bd41c5678f0ed4b52",
|
|
||||||
"userTokenReadOnly": true,
|
|
||||||
"allowBots": false,
|
|
||||||
"requireMention": false,
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"historyLimit": 50,
|
|
||||||
"reactionNotifications": "all",
|
|
||||||
"thread": {
|
|
||||||
"historyScope": "thread",
|
|
||||||
"inheritParent": true
|
|
||||||
},
|
|
||||||
"actions": {
|
|
||||||
"reactions": true,
|
|
||||||
"messages": true,
|
|
||||||
"pins": true,
|
|
||||||
"memberInfo": true,
|
|
||||||
"emojiList": true
|
|
||||||
},
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"U0AE3J9MDND"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"C0AEJV13TEU": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0ADJALL61Z": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AD9F7LYNB": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AE4CESCC9": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"C0AEB39CE5U": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18800,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18800",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
},
|
|
||||||
"slack": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 2,
|
|
||||||
"runs": {}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T17:31:28.215Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,33 +0,0 @@
|
|||||||
{
|
|
||||||
"c7a43186fc53dd92cdda4d8bd20da245783d3cb448bcf259f1699a6ad1a9e214": {
|
|
||||||
"deviceId": "c7a43186fc53dd92cdda4d8bd20da245783d3cb448bcf259f1699a6ad1a9e214",
|
|
||||||
"publicKey": "LHJxBXCBV90pwtWDg4vT6zkbRzlLEEHh4QQ8mS_g8i4",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "cli",
|
|
||||||
"clientMode": "cli",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "0047cd91d7ee435f85401bd45d527175",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771249198394,
|
|
||||||
"lastUsedAtMs": 1771249230595
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771249198394,
|
|
||||||
"approvedAtMs": 1771249198394
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18824
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "c7a43186fc53dd92cdda4d8bd20da245783d3cb448bcf259f1699a6ad1a9e214",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "0047cd91d7ee435f85401bd45d527175",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771249230600
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "c7a43186fc53dd92cdda4d8bd20da245783d3cb448bcf259f1699a6ad1a9e214",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEALHJxBXCBV90pwtWDg4vT6zkbRzlLEEHh4QQ8mS/g8i4=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIGiHK6+mMAi8X0ZZV2oPj5J0uv4kqZNyG721Qfe1P0lF\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771249198345
|
|
||||||
}
|
|
||||||
@@ -1,196 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-nx-expert.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "anthropic/claude-sonnet-4-5"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
\"contextPruning\": {\n \"mode\": \"cache-ttl\",\n \"ttl\": \"15m\",\n \"keepLastAssistants\": 3,\n \"softTrimRatio\": 0.6,\n \"hardClearRatio\": 0.8,\n \"minPrunableToolChars\": 2000\n },\n \"heartbeat\": {\n \"every\": \"30m\",\n \"target\": \"discord\"\n }\n },\n \"list\": [\n {\n \"id\": \"main\",\n \"default\": true,\n \"name\": \"Atomizer NX Expert\",\n \"workspace\": \"/home/papa/atomizer/workspaces/nx-expert\",\n \"model\": \"anthropic/claude-sonnet-4-5\",\n \"identity\": {\n \"name\": \"Atomizer NX Expert\",\n \"theme\": \"Siemens NX/CAD/CAE deep specialist.\",\n \"emoji\": \"\\ud83d\\udda5\\ufe0f\"\n },\n \"groupChat\": {\n \"mentionPatterns\": [\n \"@nx-expert\",\n \"@NX Expert\",\n \"\\ud83d\\udda5\\ufe0f\"\n ]\n },\n \"subagents\": {\n \"allowAgents\": [\n \"*\"\n ]\n }\n }\n ]\n },\n \"messages\": {\n \"responsePrefix\": \"[{identity.name}] \",\n \"queue\": {\n \"mode\": \"collect\",\n \"debounceMs\": 2000,\n \"cap\": 20\n },\n \"inbound\": {\n \"debounceMs\": 3000\n },\n \"ackReaction\": \"\",\n \"ackReactionScope\": \"group-mentions\"\n },\n \"commands\": {\n \"native\": \"auto\",\n \"nativeSkills\": \"auto\"\n },\n \"hooks\": {\n \"enabled\": true,\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\",\n \"allowRequestSessionKey\": true,\n \"allowedSessionKeyPrefixes\": [\n \"agent:\",\n \"hook:\"\n ],\n \"allowedAgentIds\": [\n \"*\"\n ]\n },\n \"channels\": {\n \"discord\": {\n \"enabled\": true,\n \"commands\": {\n \"native\": false\n },\n \"groupPolicy\": \"allowlist\",\n \"dm\": {\n \"enabled\": true,\n \"policy\": \"allowlist\",\n \"allowFrom\": [\n \"user:719982779793932419\"\n ]\n },\n \"guilds\": {\n \"1471858733452890132\": {\n \"requireMention\": true,\n \"users\": [\n \"user:719982779793932419\"\n ],\n \"channels\": {\n \"feed\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"technical\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"rnd\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"lessons-learned\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"knowledge-base\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"it\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"proj-hydrotech-beam\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"dm-nx-expert\": {\n \"allow\": true,\n \"requireMention\": false\n },\n \"hq\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"reports\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"announcements\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"agent-logs\": {\n \"allow\": true,\n \"requireMention\": true\n }\n }\n }\n },\n \"token\": \"${DISCORD_TOKEN_NX_EXPERT}\",\n \"allowBots\": true\n }\n },\n \"gateway\": {\n \"port\": 18824,\n \"mode\": \"local\",\n \"bind\": \"loopback\",\n \"auth\": {\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n },\n \"remote\": {\n \"url\": \"ws://127.0.0.1:18824\",\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n }\n },\n \"skills\": {\n \"load\": {\n \"extraDirs\": [\n \"/home/papa/atomizer/skills\"\n ]\n }\n },\n \"plugins\": {\n \"entries\": {\n \"discord\": {\n \"enabled\": true\n }\n }\n },\n \"talk\": {\n \"apiKey\": \"sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398\"\n }\n}
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer NX Expert",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/nx-expert",
|
|
||||||
"model": "anthropic/claude-sonnet-4-5",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer NX Expert",
|
|
||||||
"theme": "Siemens NX/CAD/CAE deep specialist.",
|
|
||||||
"emoji": "\ud83d\udda5\ufe0f"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@nx-expert",
|
|
||||||
"@NX Expert",
|
|
||||||
"\ud83d\udda5\ufe0f"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-nx-expert": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_NX_EXPERT}"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18824,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18824",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T17:31:49.862Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,34 +0,0 @@
|
|||||||
{
|
|
||||||
"b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd": {
|
|
||||||
"deviceId": "b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd",
|
|
||||||
"publicKey": "vBuKXBCdvM0VJ1yg9Mydmh7tQzEjic9L1GwhQ_w1Rrg",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "gateway-client",
|
|
||||||
"clientMode": "backend",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "d3ed19d5f143466db08fc47693ef1121",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771083768041,
|
|
||||||
"lastUsedAtMs": 1771249229100
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771083768040,
|
|
||||||
"approvedAtMs": 1771083768040,
|
|
||||||
"displayName": "agent"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18816
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "d3ed19d5f143466db08fc47693ef1121",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771249229113
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "b37d0899686161eea4515f7c59d36f875de30b80e30236119067655238d920fd",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAvBuKXBCdvM0VJ1yg9Mydmh7tQzEjic9L1GwhQ/w1Rrg=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIOC89NY6pTuwDTSfHzB0okQdmEwSk3YKm51eYiBh+Jo0\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771083768008
|
|
||||||
}
|
|
||||||
Binary file not shown.
@@ -1,196 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-optimizer.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "anthropic/claude-sonnet-4-5"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
\"contextPruning\": {\n \"mode\": \"cache-ttl\",\n \"ttl\": \"15m\",\n \"keepLastAssistants\": 3,\n \"softTrimRatio\": 0.6,\n \"hardClearRatio\": 0.8,\n \"minPrunableToolChars\": 2000\n },\n \"heartbeat\": {\n \"every\": \"30m\",\n \"target\": \"discord\"\n }\n },\n \"list\": [\n {\n \"id\": \"main\",\n \"default\": true,\n \"name\": \"Atomizer Optimizer\",\n \"workspace\": \"/home/papa/atomizer/workspaces/optimizer\",\n \"model\": \"anthropic/claude-sonnet-4-5\",\n \"identity\": {\n \"name\": \"Atomizer Optimizer\",\n \"theme\": \"Optimization algorithm specialist. Data-driven, strategic, skeptical of too-good results.\",\n \"emoji\": \"\\u26a1\"\n },\n \"groupChat\": {\n \"mentionPatterns\": [\n \"@optimizer\",\n \"@Optimizer\",\n \"\\u26a1\"\n ]\n },\n \"subagents\": {\n \"allowAgents\": [\n \"*\"\n ]\n }\n }\n ]\n },\n \"messages\": {\n \"responsePrefix\": \"[{identity.name}] \",\n \"queue\": {\n \"mode\": \"collect\",\n \"debounceMs\": 2000,\n \"cap\": 20\n },\n \"inbound\": {\n \"debounceMs\": 3000\n },\n \"ackReaction\": \"\",\n \"ackReactionScope\": \"group-mentions\"\n },\n \"commands\": {\n \"native\": \"auto\",\n \"nativeSkills\": \"auto\"\n },\n \"hooks\": {\n \"enabled\": true,\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\",\n \"allowRequestSessionKey\": true,\n \"allowedSessionKeyPrefixes\": [\n \"agent:\",\n \"hook:\"\n ],\n \"allowedAgentIds\": [\n \"*\"\n ]\n },\n \"channels\": {\n \"discord\": {\n \"enabled\": true,\n \"commands\": {\n \"native\": false\n },\n \"groupPolicy\": \"allowlist\",\n \"dm\": {\n \"enabled\": true,\n \"policy\": \"allowlist\",\n \"allowFrom\": [\n \"user:719982779793932419\"\n ]\n },\n \"guilds\": {\n \"1471858733452890132\": {\n \"requireMention\": true,\n \"users\": [\n \"user:719982779793932419\"\n ],\n \"channels\": {\n \"feed\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"technical\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"rnd\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"lessons-learned\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"knowledge-base\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"it\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"proj-hydrotech-beam\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"dm-optimizer\": {\n \"allow\": true,\n \"requireMention\": false\n },\n \"hq\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"reports\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"announcements\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"agent-logs\": {\n \"allow\": true,\n \"requireMention\": true\n }\n }\n }\n },\n \"token\": \"${DISCORD_TOKEN_OPTIMIZER}\",\n \"allowBots\": true\n }\n },\n \"gateway\": {\n \"port\": 18816,\n \"mode\": \"local\",\n \"bind\": \"loopback\",\n \"auth\": {\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n },\n \"remote\": {\n \"url\": \"ws://127.0.0.1:18816\",\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n }\n },\n \"skills\": {\n \"load\": {\n \"extraDirs\": [\n \"/home/papa/atomizer/skills\"\n ]\n }\n },\n \"plugins\": {\n \"entries\": {\n \"discord\": {\n \"enabled\": true\n }\n }\n },\n \"talk\": {\n \"apiKey\": \"sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398\"\n }\n}
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Optimizer",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/optimizer",
|
|
||||||
"model": "anthropic/claude-sonnet-4-5",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Optimizer",
|
|
||||||
"theme": "Optimization algorithm specialist. Data-driven, strategic, skeptical of too-good results.",
|
|
||||||
"emoji": "\u26a1"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@optimizer",
|
|
||||||
"@Optimizer",
|
|
||||||
"\u26a1"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-optimizer": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_OPTIMIZER}"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18816,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18816",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T17:31:47.030Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,33 +0,0 @@
|
|||||||
{
|
|
||||||
"5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3": {
|
|
||||||
"deviceId": "5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3",
|
|
||||||
"publicKey": "lNlX0xhSVQGvufMKYuLx1C2Ed0lS9uK22f6N4MmOoPU",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "cli",
|
|
||||||
"clientMode": "cli",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "b6a85b3c2543407d846acb863d3d0545",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771113526822,
|
|
||||||
"lastUsedAtMs": 1771292615826
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771113526821,
|
|
||||||
"approvedAtMs": 1771113526821
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18808
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "b6a85b3c2543407d846acb863d3d0545",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771292615838
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "5b8eb09786f8b9cd617a1f96b42fb479d73c6fc421b168aa47124a4d74595dc3",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAlNlX0xhSVQGvufMKYuLx1C2Ed0lS9uK22f6N4MmOoPU=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIBKcz+McFIShhev0zkU/2LDwcn76MtHqmA4dKZNXX4/d\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771113526792
|
|
||||||
}
|
|
||||||
Binary file not shown.
@@ -1,198 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-secretary.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "google/gemini-2.5-pro"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
\"contextPruning\": {\n \"mode\": \"cache-ttl\",\n \"ttl\": \"15m\",\n \"keepLastAssistants\": 3,\n \"softTrimRatio\": 0.6,\n \"hardClearRatio\": 0.8,\n \"minPrunableToolChars\": 2000\n },\n \"heartbeat\": {\n \"every\": \"30m\",\n \"target\": \"discord\"\n }\n },\n \"list\": [\n {\n \"id\": \"main\",\n \"default\": true,\n \"name\": \"Atomizer Secretary\",\n \"workspace\": \"/home/papa/atomizer/workspaces/secretary\",\n \"model\": \"google/gemini-2.5-pro\",\n \"identity\": {\n \"name\": \"Atomizer Secretary\",\n \"theme\": \"Executive assistant. Filters noise, summarizes, escalates what matters. Organized and proactive.\",\n \"emoji\": \"\\ud83d\\udccb\"\n },\n \"groupChat\": {\n \"mentionPatterns\": [\n \"@secretary\",\n \"@Secretary\",\n \"\\ud83d\\udccb\"\n ]\n },\n \"subagents\": {\n \"allowAgents\": [\n \"*\"\n ]\n }\n }\n ]\n },\n \"messages\": {\n \"responsePrefix\": \"[{identity.name}] \",\n \"queue\": {\n \"mode\": \"collect\",\n \"debounceMs\": 2000,\n \"cap\": 20\n },\n \"inbound\": {\n \"debounceMs\": 3000\n },\n \"ackReaction\": \"\",\n \"ackReactionScope\": \"group-mentions\"\n },\n \"commands\": {\n \"native\": \"auto\",\n \"nativeSkills\": \"auto\"\n },\n \"hooks\": {\n \"enabled\": true,\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\",\n \"allowRequestSessionKey\": true,\n \"allowedSessionKeyPrefixes\": [\n \"agent:\",\n \"hook:\"\n ],\n \"allowedAgentIds\": [\n \"*\"\n ]\n },\n \"channels\": {\n \"discord\": {\n \"enabled\": true,\n \"commands\": {\n \"native\": false\n },\n \"groupPolicy\": \"allowlist\",\n \"dm\": {\n \"enabled\": true,\n \"policy\": \"allowlist\",\n \"allowFrom\": [\n \"user:719982779793932419\"\n ]\n },\n \"guilds\": {\n \"1471858733452890132\": {\n \"requireMention\": true,\n \"users\": [\n \"user:719982779793932419\"\n ],\n \"channels\": {\n \"feed\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"technical\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"rnd\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"lessons-learned\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"knowledge-base\": {\n \"allow\": true,\n \"requireMention\": true\n },\
|
|
||||||
\"it\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"proj-hydrotech-beam\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"dm-secretary\": {\n \"allow\": true,\n \"requireMention\": false\n },\n \"hq\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"reports\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"announcements\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"agent-logs\": {\n \"allow\": true,\n \"requireMention\": true\n }\n }\n }\n },\n \"token\": \"${DISCORD_TOKEN_SECRETARY}\",\n \"allowBots\": true\n }\n },\n \"gateway\": {\n \"port\": 18808,\n \"mode\": \"local\",\n \"bind\": \"loopback\",\n \"auth\": {\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n },\n \"remote\": {\n \"url\": \"ws://127.0.0.1:18808\",\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n }\n },\n \"skills\": {\n \"load\": {\n \"extraDirs\": [\n \"/home/papa/atomizer/skills\"\n ]\n }\n },\n \"plugins\": {\n \"entries\": {\n \"discord\": {\n \"enabled\": true\n }\n }\n },\n \"talk\": {\n \"apiKey\": \"sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398\"\n }\n}
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Secretary",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/secretary",
|
|
||||||
"model": "google/gemini-2.5-pro",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Secretary",
|
|
||||||
"theme": "Executive assistant. Filters noise, summarizes, escalates what matters. Organized and proactive.",
|
|
||||||
"emoji": "\ud83d\udccb"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@secretary",
|
|
||||||
"@Secretary",
|
|
||||||
"\ud83d\udccb"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-secretary": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_SECRETARY}",
|
|
||||||
"allowBots": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18808,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18808",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 2,
|
|
||||||
"runs": {}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T23:34:54.914Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,33 +0,0 @@
|
|||||||
{
|
|
||||||
"433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9": {
|
|
||||||
"deviceId": "433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9",
|
|
||||||
"publicKey": "B3KZQ84BJ7Kr8aJ_1NYsJUASfd95pfvxe3HMBnGYDnQ",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "cli",
|
|
||||||
"clientMode": "cli",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "7e2455df825246b7b8f1832bbd610988",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771083773436,
|
|
||||||
"lastUsedAtMs": 1771249353247
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771083773436,
|
|
||||||
"approvedAtMs": 1771083773436
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18820
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "7e2455df825246b7b8f1832bbd610988",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771249353264
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "433b7aba11bf3243e9285b5a1cad3000206cda35763015596b4f753d47d8caa9",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEAB3KZQ84BJ7Kr8aJ/1NYsJUASfd95pfvxe3HMBnGYDnQ=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIM3mdAQ/QFl9zqVyc2Lg/F8ZEJJc4219O2+0S6ynB+hB\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771083773401
|
|
||||||
}
|
|
||||||
Binary file not shown.
@@ -1,196 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-study-builder.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "anthropic/claude-sonnet-4-5"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
\"contextPruning\": {\n \"mode\": \"cache-ttl\",\n \"ttl\": \"15m\",\n \"keepLastAssistants\": 3,\n \"softTrimRatio\": 0.6,\n \"hardClearRatio\": 0.8,\n \"minPrunableToolChars\": 2000\n },\n \"heartbeat\": {\n \"every\": \"30m\",\n \"target\": \"discord\"\n }\n },\n \"list\": [\n {\n \"id\": \"main\",\n \"default\": true,\n \"name\": \"Atomizer Study Builder\",\n \"workspace\": \"/home/papa/atomizer/workspaces/study-builder\",\n \"model\": \"google/gemini-2.5-pro\",\n \"identity\": {\n \"name\": \"Atomizer Study Builder\",\n \"theme\": \"Meticulous study code engineer. Writes production-quality optimization scripts. Pattern-driven.\",\n \"emoji\": \"\\ud83c\\udfd7\\ufe0f\"\n },\n \"groupChat\": {\n \"mentionPatterns\": [\n \"@study-builder\",\n \"@Study Builder\",\n \"\\ud83c\\udfd7\\ufe0f\"\n ]\n },\n \"subagents\": {\n \"allowAgents\": [\n \"*\"\n ]\n }\n }\n ]\n },\n \"messages\": {\n \"responsePrefix\": \"[{identity.name}] \",\n \"queue\": {\n \"mode\": \"collect\",\n \"debounceMs\": 2000,\n \"cap\": 20\n },\n \"inbound\": {\n \"debounceMs\": 3000\n },\n \"ackReaction\": \"\",\n \"ackReactionScope\": \"group-mentions\"\n },\n \"commands\": {\n \"native\": \"auto\",\n \"nativeSkills\": \"auto\"\n },\n \"hooks\": {\n \"enabled\": true,\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\",\n \"allowRequestSessionKey\": true,\n \"allowedSessionKeyPrefixes\": [\n \"agent:\",\n \"hook:\"\n ],\n \"allowedAgentIds\": [\n \"*\"\n ]\n },\n \"channels\": {\n \"discord\": {\n \"enabled\": true,\n \"commands\": {\n \"native\": false\n },\n \"groupPolicy\": \"allowlist\",\n \"dm\": {\n \"enabled\": true,\n \"policy\": \"allowlist\",\n \"allowFrom\": [\n \"user:719982779793932419\"\n ]\n },\n \"guilds\": {\n \"1471858733452890132\": {\n \"requireMention\": true,\n \"users\": [\n \"user:719982779793932419\"\n ],\n \"channels\": {\n \"feed\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"technical\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"rnd\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"lessons-learned\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"knowledge-base\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"it\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"proj-hydrotech-beam\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"dm-study-builder\": {\n \"allow\": true,\n \"requireMention\": false\n },\n \"hq\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"reports\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"announcements\": {\n \"allow\": true,\n \"requireMention\": true\n },\n \"agent-logs\": {\n \"allow\": true,\n \"requireMention\": true\n }\n }\n }\n },\n \"token\": \"${DISCORD_TOKEN_STUDY_BUILDER}\",\n \"allowBots\": true\n }\n },\n \"gateway\": {\n \"port\": 18820,\n \"mode\": \"local\",\n \"bind\": \"loopback\",\n \"auth\": {\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n },\n \"remote\": {\n \"url\": \"ws://127.0.0.1:18820\",\n \"token\": \"31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1\"\n }\n },\n \"skills\": {\n \"load\": {\n \"extraDirs\": [\n \"/home/papa/atomizer/skills\"\n ]\n }\n },\n \"plugins\": {\n \"entries\": {\n \"discord\": {\n \"enabled\": true\n }\n }\n },\n \"talk\": {\n \"apiKey\": \"sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398\"\n }\n}
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Study Builder",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/study-builder",
|
|
||||||
"model": "google/gemini-2.5-pro",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Study Builder",
|
|
||||||
"theme": "Meticulous study code engineer. Writes production-quality optimization scripts. Pattern-driven.",
|
|
||||||
"emoji": "\ud83c\udfd7\ufe0f"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@study-builder",
|
|
||||||
"@Study Builder",
|
|
||||||
"\ud83c\udfd7\ufe0f"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-study-builder": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_STUDY_BUILDER}"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18820,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18820",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T23:34:58.964Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"jobs": []
|
|
||||||
}
|
|
||||||
@@ -1,33 +0,0 @@
|
|||||||
{
|
|
||||||
"931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7": {
|
|
||||||
"deviceId": "931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7",
|
|
||||||
"publicKey": "7o6DeC6QPO2-Q1KFlXgeDVB2mvWhoBMd-W1OKJwd_pc",
|
|
||||||
"platform": "linux",
|
|
||||||
"clientId": "cli",
|
|
||||||
"clientMode": "cli",
|
|
||||||
"role": "operator",
|
|
||||||
"roles": [
|
|
||||||
"operator"
|
|
||||||
],
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "7120ab625b624d8eb4cc0c7a6f1649dd",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"createdAtMs": 1771083760054,
|
|
||||||
"lastUsedAtMs": 1771249081376
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"createdAtMs": 1771083760053,
|
|
||||||
"approvedAtMs": 1771083760053
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
OPENCLAW_GATEWAY_PORT=18804
|
|
||||||
@@ -1,16 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7",
|
|
||||||
"tokens": {
|
|
||||||
"operator": {
|
|
||||||
"token": "7120ab625b624d8eb4cc0c7a6f1649dd",
|
|
||||||
"role": "operator",
|
|
||||||
"scopes": [
|
|
||||||
"operator.admin",
|
|
||||||
"operator.approvals",
|
|
||||||
"operator.pairing"
|
|
||||||
],
|
|
||||||
"updatedAtMs": 1771249081389
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 1,
|
|
||||||
"deviceId": "931d2d32787e5e206862f6de3064131e69bd61d2a8edb32ac9a633ee9c997cd7",
|
|
||||||
"publicKeyPem": "-----BEGIN PUBLIC KEY-----\nMCowBQYDK2VwAyEA7o6DeC6QPO2+Q1KFlXgeDVB2mvWhoBMd+W1OKJwd/pc=\n-----END PUBLIC KEY-----\n",
|
|
||||||
"privateKeyPem": "-----BEGIN PRIVATE KEY-----\nMC4CAQAwBQYDK2VwBCIEIPmHG7m2/xG4CKlGz7ITTLtx8XZY9U3ba09nfjlNZnu7\n-----END PRIVATE KEY-----\n",
|
|
||||||
"createdAtMs": 1771083760022
|
|
||||||
}
|
|
||||||
Binary file not shown.
@@ -1,373 +0,0 @@
|
|||||||
{
|
|
||||||
"logging": {
|
|
||||||
"level": "trace",
|
|
||||||
"file": "/tmp/openclaw/atomizer-tech-lead.log",
|
|
||||||
"redactSensitive": "tools"
|
|
||||||
},
|
|
||||||
"agents": {
|
|
||||||
"defaults": {
|
|
||||||
"model": {
|
|
||||||
"primary": "anthropic/claude-opus-4-6"
|
|
||||||
},
|
|
||||||
"skipBootstrap": true,
|
|
||||||
"bootstrapMaxChars": 25000,
|
|
||||||
"userTimezone": "America/Toronto",
|
|
||||||
"typingIntervalSeconds": 4,
|
|
||||||
"typingMode": "instant",
|
|
||||||
"maxConcurrent": 4,
|
|
||||||
"subagents": {
|
|
||||||
"maxConcurrent": 4
|
|
||||||
},
|
|
||||||
"compaction": {
|
|
||||||
"mode": "safeguard",
|
|
||||||
"memoryFlush": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"contextPruning": {
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
},
|
|
||||||
"heartbeat": {
|
|
||||||
"every": "30m",
|
|
||||||
"target": "discord"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Tech Lead",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/technical-lead",
|
|
||||||
"model": "anthropic/claude-opus-4-6",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Tech Lead",
|
|
||||||
"theme": "Deep FEA/optimization expert. Breaks down problems, leads R&D, reviews technical work. Rigorous and thorough.",
|
|
||||||
"emoji": "\ud83d\udd27"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@tech-lead",
|
|
||||||
"@technical-lead",
|
|
||||||
"@Technical Lead",
|
|
||||||
"\ud83d\udd27"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-tech-lead": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_TECH_LEAD}",
|
|
||||||
"allowBots": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18804,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18804",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
"mode": "cache-ttl",
|
|
||||||
"ttl": "15m",
|
|
||||||
"keepLastAssistants": 3,
|
|
||||||
"softTrimRatio": 0.6,
|
|
||||||
"hardClearRatio": 0.8,
|
|
||||||
"minPrunableToolChars": 2000
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"list": [
|
|
||||||
{
|
|
||||||
"id": "main",
|
|
||||||
"default": true,
|
|
||||||
"name": "Atomizer Tech Lead",
|
|
||||||
"workspace": "/home/papa/atomizer/workspaces/technical-lead",
|
|
||||||
"model": "anthropic/claude-opus-4-6",
|
|
||||||
"identity": {
|
|
||||||
"name": "Atomizer Tech Lead",
|
|
||||||
"theme": "Deep FEA/optimization expert. Breaks down problems, leads R&D, reviews technical work. Rigorous and thorough.",
|
|
||||||
"emoji": "\ud83d\udd27"
|
|
||||||
},
|
|
||||||
"groupChat": {
|
|
||||||
"mentionPatterns": [
|
|
||||||
"@tech-lead",
|
|
||||||
"@technical-lead",
|
|
||||||
"@Technical Lead",
|
|
||||||
"\ud83d\udd27"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"subagents": {
|
|
||||||
"allowAgents": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
}
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"messages": {
|
|
||||||
"responsePrefix": "[{identity.name}] ",
|
|
||||||
"queue": {
|
|
||||||
"mode": "collect",
|
|
||||||
"debounceMs": 2000,
|
|
||||||
"cap": 20
|
|
||||||
},
|
|
||||||
"inbound": {
|
|
||||||
"debounceMs": 3000
|
|
||||||
},
|
|
||||||
"ackReaction": "",
|
|
||||||
"ackReactionScope": "group-mentions"
|
|
||||||
},
|
|
||||||
"commands": {
|
|
||||||
"native": "auto",
|
|
||||||
"nativeSkills": "auto"
|
|
||||||
},
|
|
||||||
"hooks": {
|
|
||||||
"enabled": true,
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1",
|
|
||||||
"allowRequestSessionKey": true,
|
|
||||||
"allowedSessionKeyPrefixes": [
|
|
||||||
"agent:",
|
|
||||||
"hook:"
|
|
||||||
],
|
|
||||||
"allowedAgentIds": [
|
|
||||||
"*"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"channels": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true,
|
|
||||||
"commands": {
|
|
||||||
"native": false
|
|
||||||
},
|
|
||||||
"groupPolicy": "allowlist",
|
|
||||||
"dm": {
|
|
||||||
"enabled": true,
|
|
||||||
"policy": "allowlist",
|
|
||||||
"allowFrom": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
]
|
|
||||||
},
|
|
||||||
"guilds": {
|
|
||||||
"1471858733452890132": {
|
|
||||||
"requireMention": true,
|
|
||||||
"users": [
|
|
||||||
"user:719982779793932419"
|
|
||||||
],
|
|
||||||
"channels": {
|
|
||||||
"feed": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"technical": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"rnd": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"lessons-learned": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"knowledge-base": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"it": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"proj-hydrotech-beam": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"dm-tech-lead": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": false
|
|
||||||
},
|
|
||||||
"hq": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"reports": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"announcements": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
},
|
|
||||||
"agent-logs": {
|
|
||||||
"allow": true,
|
|
||||||
"requireMention": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"token": "${DISCORD_TOKEN_TECH_LEAD}",
|
|
||||||
"allowBots": true
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"gateway": {
|
|
||||||
"port": 18804,
|
|
||||||
"mode": "local",
|
|
||||||
"bind": "loopback",
|
|
||||||
"auth": {
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
},
|
|
||||||
"remote": {
|
|
||||||
"url": "ws://127.0.0.1:18804",
|
|
||||||
"token": "31422bb39bc9e7a4d34f789d8a7cbc582dece8dd170dadd1"
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"skills": {
|
|
||||||
"load": {
|
|
||||||
"extraDirs": [
|
|
||||||
"/home/papa/atomizer/skills"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"plugins": {
|
|
||||||
"entries": {
|
|
||||||
"discord": {
|
|
||||||
"enabled": true
|
|
||||||
}
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"talk": {
|
|
||||||
"apiKey": "sk_d8aa4795f7124ed052fa7de66a28a7739b8bb82789c2f398"
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,4 +0,0 @@
|
|||||||
{
|
|
||||||
"version": 2,
|
|
||||||
"runs": {}
|
|
||||||
}
|
|
||||||
@@ -1,5 +0,0 @@
|
|||||||
{
|
|
||||||
"lastCheckedAt": "2026-02-16T16:42:16.153Z",
|
|
||||||
"lastNotifiedVersion": "2026.2.15",
|
|
||||||
"lastNotifiedTag": "latest"
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{"signin":{"active_accounts_last_emitted":"13415642725926393"},"uninstall_metrics":{"installation_date2":"1771169125"},"user_experience_metrics":{"limited_entropy_randomization_source":"07B50ADFDCDA992431D7AE73C842EB3D","low_entropy_source3":3443,"provisional_client_id":"c97abc28-8817-4c37-95fe-e82e4bc69681","pseudo_low_entropy_source":5583,"stability":{"browser_last_live_timestamp":"13415642725922854"}}}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
{"profile":{"info_cache":{"Default":{"default_avatar_fill_color":-47872,"default_avatar_stroke_color":-47872,"name":"openclaw","profile_color":"#FF4500","profile_color_seed":-47872,"profile_highlight_color":-47872,"shortcut_name":"openclaw","user_color":"#FF4500","user_name":"openclaw"}}},"signin":{"active_accounts_last_emitted":"13415642736020447"},"uninstall_metrics":{"installation_date2":"1771169136"},"user_experience_metrics":{"limited_entropy_randomization_source":"0A769CC3BC7D6B93E71DB6F6DB53BF3B","low_entropy_source3":7110,"provisional_client_id":"acfa085f-9288-4519-a5ca-e377359807ca","pseudo_low_entropy_source":3584,"stability":{"browser_last_live_timestamp":"13415642736015909"}},"variations_crash_streak":1}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
1771169135883
|
|
||||||
Binary file not shown.
Binary file not shown.
@@ -1,19 +0,0 @@
|
|||||||
{
|
|
||||||
"profile": {
|
|
||||||
"name": "openclaw",
|
|
||||||
"profile_color": "#FF4500",
|
|
||||||
"user_color": "#FF4500"
|
|
||||||
},
|
|
||||||
"autogenerated": {
|
|
||||||
"theme": {
|
|
||||||
"color": -47872
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"browser": {
|
|
||||||
"theme": {
|
|
||||||
"user_color2": -47872
|
|
||||||
}
|
|
||||||
},
|
|
||||||
"exit_type": "Normal",
|
|
||||||
"exited_cleanly": true
|
|
||||||
}
|
|
||||||
@@ -1,17 +0,0 @@
|
|||||||
{
|
|
||||||
"profile": {
|
|
||||||
"info_cache": {
|
|
||||||
"Default": {
|
|
||||||
"name": "openclaw",
|
|
||||||
"shortcut_name": "openclaw",
|
|
||||||
"user_name": "openclaw",
|
|
||||||
"profile_color": "#FF4500",
|
|
||||||
"user_color": "#FF4500",
|
|
||||||
"profile_color_seed": -47872,
|
|
||||||
"profile_highlight_color": -47872,
|
|
||||||
"default_avatar_fill_color": -47872,
|
|
||||||
"default_avatar_stroke_color": -47872
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
2527432141186001222
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
clawdbot-351069
|
|
||||||
@@ -1 +0,0 @@
|
|||||||
/tmp/com.google.Chrome.GdJr7i/SingletonSocket
|
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user